| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:t-Butyl 5-broMo-2-MethylphenylcarbaMate
CAS:221538-07-4
Purity:98% Package:1g,5g,25g
|
| Company Name: |
Wuhan Chemwish Technology Co., Ltd
|
| Tel: |
86-027-67849912 |
| Email: |
sales@chemwish.com |
| Products Intro: |
Product Name:t-Butyl5-broMo-2-MethylphenylcarbaMate
CAS:221538-07-4
Purity:98% Package:1g;5g;25g;50g;100g
|
|
| | 2-BOC-AMINO-4-BROMOTOLUENE Basic information |
| Product Name: | 2-BOC-AMINO-4-BROMOTOLUENE | | Synonyms: | 2-BOC-AMINO-4-BROMOTOLUENE;t-Butyl5-bromo-2-methylphenylcarbamate;(5-Bromo-2-methylphenyl)carbamic acid, 1,1-dimethylethyl ester;N-Boc-5-bromo-2-methylaniline;(5-Bromo-2-methyl-phenyl)-carbamic acid tert-butyl ester;tert-butyl N-(5-bromo-2-methylphenyl)carbamate;Carbamic acid, N-(5-bromo-2-methylphenyl)-, 1,1-dimethylethyl ester;5-Bromo-N-Boc-2-methylaniline | | CAS: | 221538-07-4 | | MF: | C12H16BrNO2 | | MW: | 286.16 | | EINECS: | | | Product Categories: | | | Mol File: | 221538-07-4.mol |  |
| | 2-BOC-AMINO-4-BROMOTOLUENE Chemical Properties |
| Melting point | 115-118°C | | storage temp. | Store at room temperature | | form | solid | | Appearance | Light yellow to light brown Solid | | InChI | 1S/C12H16BrNO2/c1-8-5-6-9(13)7-10(8)14-11(15)16-12(2,3)4/h5-7H,1-4H3,(H,14,15) | | InChIKey | BNVTXJGOUMSADR-UHFFFAOYSA-N | | SMILES | Cc1ccc(Br)cc1NC(=O)OC(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-BOC-AMINO-4-BROMOTOLUENE Usage And Synthesis |
| | 2-BOC-AMINO-4-BROMOTOLUENE Preparation Products And Raw materials |
|