|
|
| | N-Desethyl-N-propyl Oxybutynin Basic information |
| | N-Desethyl-N-propyl Oxybutynin Chemical Properties |
| Melting point | NA | | storage temp. | -20°C Freezer | | solubility | Acetone, Chloroform (Slightly), DMF, Hexane (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Beige Oil | | SMILES | O=C(C(C1=CC=CC=C1)(C2CCCCC2)O)OCC#CCN(CCC)CC |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N-Desethyl-N-propyl Oxybutynin Usage And Synthesis |
| Chemical Properties | Yellow OIl | | Uses | N-Desethyl-N-propyl Oxybutynin (Oxybutynin EP Impurity E) is an Oxybutynin impurity. |
| | N-Desethyl-N-propyl Oxybutynin Preparation Products And Raw materials |
|