|
|
| | (S)-Duloxetine SuccinaMide Basic information |
| | (S)-Duloxetine SuccinaMide Chemical Properties |
| Melting point | 70-74°C | | Boiling point | 641.7±55.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.92±0.10(Predicted) | | color | Off-White to Light Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C22H23NO4S/c1-23(21(24)11-12-22(25)26)14-13-19(20-10-5-15-28-20)27-18-9-4-7-16-6-2-3-8-17(16)18/h2-10,15,19H,11-14H2,1H3,(H,25,26)/t19-/m0/s1 | | InChIKey | AJLVEKJDKWHFDD-IBGZPJMESA-N | | SMILES | C(O)(=O)CCC(N(C)CC[C@H](OC1=C2C(C=CC=C2)=CC=C1)C1SC=CC=1)=O |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | (S)-Duloxetine SuccinaMide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An impurity of Duloxetine hydrochloride (D721000). It is formed by interaction of Duloxetine-HCl with enteric polymers. Duloxetine USP Related Compound H. |
| | (S)-Duloxetine SuccinaMide Preparation Products And Raw materials |
|