| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Oxibendazole-D7
Remarks:CS-W-00056
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Oxibendazole-D7
CAS:1173019-44-7
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Oxibendazole-d7
CAS:1173019-44-7
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:Oxibendazole-D7
CAS:1173019-44-7
Purity:98%+ Package:5g;1g;500mg;100mg;25mg;10mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Oxibendazole-d7
CAS:1173019-44-7
Purity:NULL Package:10mg;1mg;2.5mg;5mg Remarks:NULL
|
|
| | Oxibendazole D7 Basic information |
| Product Name: | Oxibendazole D7 | | Synonyms: | Oxibendazole D7;methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropoxy)-1H-benzimidazol-2-yl]carbamate;[2H7]-Oxibendazole;Oxibendazole-d7 | | CAS: | 1173019-44-7 | | MF: | C12H8D7N3O3 | | MW: | 256.308932446 | | EINECS: | | | Product Categories: | | | Mol File: | 1173019-44-7.mol |  |
| | Oxibendazole D7 Chemical Properties |
| Major Application | forensics and toxicology
pharmaceutical (small molecule)
veterinary | | InChI | 1S/C12H15N3O3/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)/i1D3,3D2,6D2 | | InChIKey | RAOCRURYZCVHMG-JOMZKNQJSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])Oc1ccc2[nH]c(NC(=O)OC)nc2c1 |
| Hazard Codes | Xn | | Risk Statements | 63 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | Oxibendazole D7 Usage And Synthesis |
| Uses | Isotope labelled Oxibendazole (O846650), is an anthelmintic. |
| | Oxibendazole D7 Preparation Products And Raw materials |
|