1-(3-Methoxyphenyl)piperazine hydrochloride manufacturers
- OSHA middle eight
-
-
2025-12-25
- CAS:16015-70-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 2550kg
|
| | 1-(3-Methoxyphenyl)piperazine hydrochloride Basic information | | Uses |
| Product Name: | 1-(3-Methoxyphenyl)piperazine hydrochloride | | Synonyms: | Piperazine, 1-(3-Methoxyphenyl)-, Monohydrochloride;Piperazine, 1-(3-methoxyphenyl)-, hydrochloride;1-(3-methoxyphenyl)piperazine monohydrochloride;LeterMovir-003-HCl;OSHA middle eight;OSHA middle;LeterMovir Impurity 4 HCl;LeterMovir Impurity 3 HCl | | CAS: | 16015-70-6 | | MF: | C11H17ClN2O | | MW: | 228.72 | | EINECS: | | | Product Categories: | chem-chemical | | Mol File: | 16015-70-6.mol |  |
| | 1-(3-Methoxyphenyl)piperazine hydrochloride Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C11H16N2O.ClH/c1-14-11-4-2-3-10(9-11)13-7-5-12-6-8-13;/h2-4,9,12H,5-8H2,1H3;1H | | InChIKey | QOQLPYRYJCBRNU-UHFFFAOYSA-N | | SMILES | O(C1=CC=CC(N2CCNCC2)=C1)C.Cl |
| | 1-(3-Methoxyphenyl)piperazine hydrochloride Usage And Synthesis |
| Uses | 1-(3-methoxyphenyl)piperazine hydrochloride is a heterocyclic derivative and can be used as an intermediate in organic synthesis. |
| | 1-(3-Methoxyphenyl)piperazine hydrochloride Preparation Products And Raw materials |
|