- N3-PEG4-NH2
-
-
2026-02-05
- CAS:951671-92-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- azido-PEG4-amine
-
-
2025-06-07
- CAS:951671-92-4
- Min. Order: 10g
- Purity: >98.00%
- Supply Ability: 10g
|
| | O-(2-AMinoethyl)-O'-(2-azidoethyl)triethylene Glycol Basic information |
| Product Name: | O-(2-AMinoethyl)-O'-(2-azidoethyl)triethylene Glycol | | Synonyms: | O-(2-AMinoethyl)-O'-(2-azidoethyl)triethylene Glycol;14-AZIDO-3,6,9,12-TETRAOXATETRADECAN-1-YLAMINE;Azido-PEG4-NH2;PROTAC Linker 20;1-Amino-14-azido-3,6,9,12-tetraoxatetradecane;14-Amino-3,6,9,12-tetraoxatetradecanyl Azide;2-(2-{2-[2-(2-Azido-ethoxy)-ethoxy;14-azido-3,6,9,12-tetraoxatetradecane-1-amine | | CAS: | 951671-92-4 | | MF: | C10H22N4O4 | | MW: | 262.30608 | | EINECS: | | | Product Categories: | Aliphatics;Amines;Labeling and Diagnostics Reagents;Polyethyleneglycol Derivatives;PEG | | Mol File: | 951671-92-4.mol |  |
| | O-(2-AMinoethyl)-O'-(2-azidoethyl)triethylene Glycol Chemical Properties |
| density | 1.10 g/mL | | refractive index | 1.4670 to 1.4710 | | storage temp. | 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C10H22N4O4/c11-1-3-15-5-7-17-9-10-18-8-6-16-4-2-13-14-12/h1-11H2 | | InChIKey | ZMBGKXBIVYXREN-UHFFFAOYSA-N | | SMILES | NCCOCCOCCOCCOCCN=[N+]=[N-] |
| RIDADR | UN 2735 8/PG III | | WGK Germany | WGK 3 | | HS Code | 2929.90.5090 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 10 - Combustible liquids |
| | O-(2-AMinoethyl)-O'-(2-azidoethyl)triethylene Glycol Usage And Synthesis |
| Description | Amino-PEG4-azide is a very popular bifunctional crosslinker. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | O-(2-AMinoethyl)-O'-(2-azidoethyl)triethylene Glycol is a heterobifunctional polyethyleneglycol (PEG) derivative; a useful reagent used in the construction of intramolecular linkers. | | reaction suitability | reagent type: linker | | IC 50 | PEGs |
| | O-(2-AMinoethyl)-O'-(2-azidoethyl)triethylene Glycol Preparation Products And Raw materials |
|