| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Fenthoxon Sulfoxide CAS:6552-13-2 Package:500Mg,50Mg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Fenthion-oxon-sulfoxide CAS:6552-13-2 Purity:99% Package:10mg;100mg;1g
|
|
| | FENTHION-OXON-SULFOXIDE Basic information |
| | FENTHION-OXON-SULFOXIDE Chemical Properties |
| storage temp. | 2-8°C | | BRN | 8686237 | | Major Application | agriculture environmental | | InChI | 1S/C10H15O5PS/c1-8-7-9(5-6-10(8)17(4)12)15-16(11,13-2)14-3/h5-7H,1-4H3 | | InChIKey | GTZCKTIZOGTWQO-UHFFFAOYSA-N | | SMILES | O=P(OC)(OC)OC1=CC(C)=C(S(C)=O)C=C1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | 2783 | | WGK Germany | 1 | | RTECS | TC4985000 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | FENTHION-OXON-SULFOXIDE Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | A metabolite of Fenthion (FEN) |
| | FENTHION-OXON-SULFOXIDE Preparation Products And Raw materials |
|