Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester manufacturers
|
| | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Basic information |
| Product Name: | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester | | Synonyms: | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester;2-(4-Benzyloxyphenyl)ethyl decanoate;Decanoic acid, 2-[4-(phenylmethoxy)phenyl]ethyl este;2-(4-phenylmethoxyphenyl)ethyl decanoate;ecanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester;4-benzyloxyphenylethyl n-decanoate;2-[4-(phenylMethoxy)phenyl]ethyl ester;4-(Benzyloxy)phenethyl decanoate | | CAS: | 848484-93-5 | | MF: | C25H34O3 | | MW: | 382.54 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 848484-93-5.mol | ![Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Structure](CAS/GIF/848484-93-5.gif) |
| | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Chemical Properties |
| Boiling point | 497.4±25.0 °C(Predicted) | | density | 1.018±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C25H34O3/c1-2-3-4-5-6-7-11-14-25(26)27-20-19-22-15-17-24(18-16-22)28-21-23-12-9-8-10-13-23/h8-10,12-13,15-18H,2-7,11,14,19-21H2,1H3 | | InChIKey | MKSNYWIILLZWOY-UHFFFAOYSA-N | | SMILES | C(OCCC1=CC=C(OCC2=CC=CC=C2)C=C1)(=O)CCCCCCCCC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Usage And Synthesis |
| Uses |
Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester can be used as a solvent for reversible thermochromic inks and anti-counterfeiting inks
|
| | Decanoic acid, 2-[4-(phenylMethoxy)phenyl]ethyl ester Preparation Products And Raw materials |
|