3-Nitrophthalhydrazide manufacturers
- 3-Nitrophthalhydrazide
-
- $99.07
-
2026-06-05
- CAS:3682-15-3
- Min. Order: 25Kg/Drum
- Purity: 98.00%HPLC
- Supply Ability: 5tons/month
|
| | 3-Nitrophthalhydrazide Basic information | | Uses |
| Product Name: | 3-Nitrophthalhydrazide | | Synonyms: | 3-nitro-phthalic acid hydrazide;2,3-Dihydro-5-nitro-1,4-phthalazinedione
3-Nitrophthalhydrazide;1,4-Phthalazinedione, 5-nitro-2,3-dihydro-;3-Nitrophthalic Hydrazide, 97.0%(T);LABOTEST-BB LT00452959;AURORA KA-3797;2,3-DIHYDRO-5-NITRO-1,4-PHTHALAZINEDIONE;3-NITROPHTHALHYDRAZIDE | | CAS: | 3682-15-3 | | MF: | C8H5N3O4 | | MW: | 207.14 | | EINECS: | 226-776-2 | | Product Categories: | | | Mol File: | 3682-15-3.mol |  |
| | 3-Nitrophthalhydrazide Chemical Properties |
| Melting point | >300 °C (lit.) | | density | 1.555±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 9.26±0.20(Predicted) | | color | Light yellow to Brown to Dark green | | InChI | InChI=1S/C8H5N3O4/c12-7-4-2-1-3-5(11(14)15)6(4)8(13)10-9-7/h1-3H,(H,9,12)(H,10,13) | | InChIKey | YVOBBFQJMOGQOU-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)C(=O)NN1 | | CAS DataBase Reference | 3682-15-3(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Phthalazinedione, 2,3-dihydro-5-nitro- (3682-15-3) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 3-Nitrophthalhydrazide Usage And Synthesis |
| Uses | 5-Nitro-2,3-dihydrophthalazine-1,4-dione can be used as heat developable light-sensitive materials. | | Chemical Properties | Yellow powder | | Uses | 3-Nitrophthalhydrazide has been used in the preparation of 3-aminophthalhydrazidate, required for the synthesis of monoacylhydrazidate-coordinated Mn2+ and Pb2+ compounds. | | Synthesis | To the dry 1000ml three-necked flask, add 100g 3-nitrophthalic acid dimethyl ester, ethanol 140g, hydrazine hydrate (50%) 83.6g, stirring and heating to reflux, maintain the reflux reaction for 3h, cooling down with stirring, cooled to room temperature and then pumped and filtered. Crystals and then add water to dissolve, filtration, the solution and then add concentrated hydrochloric acid acid acidification to PH1.5-2, filtration, washing, drying to 60g, the appearance of light yellow crystalline powder 3-nitrophthalic acid hydrazide, yield 69%, purity 98.2%, melting point > 300 .
|
| | 3-Nitrophthalhydrazide Preparation Products And Raw materials |
|