|
|
| | [2,2'-Bipyridine]-5,5'-diMethanol Basic information | | Uses |
| Product Name: | [2,2'-Bipyridine]-5,5'-diMethanol | | Synonyms: | [2,2'-Bipyridine]-5,5'-diMethanol;5,5'-bis(hydroxyMethyl)-2,2'-bipyridine;2,2'-Bipyridine]-5,5'-diMethanol;2,2'-Bipyridine]-5,5'-diyldimethanol;5, 5'-Bis(hydroxymethyl)-2, 2'-bipyridine;[2,2'-Bipyridine]-5,5'-diyldimethanol | | CAS: | 63361-65-9 | | MF: | C12H12N2O2 | | MW: | 216.24 | | EINECS: | | | Product Categories: | | | Mol File: | 63361-65-9.mol | ![[2,2'-Bipyridine]-5,5'-diMethanol Structure](CAS/GIF/63361-65-9.gif) |
| | [2,2'-Bipyridine]-5,5'-diMethanol Chemical Properties |
| Melting point | 158-161 °C | | Boiling point | 458.7±45.0 °C(Predicted) | | density | 1.281±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 13.18±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C12H12N2O2/c15-7-9-1-3-11(13-5-9)12-4-2-10(8-16)6-14-12/h1-6,15-16H,7-8H2 | | InChIKey | DVXJDRMCWWERRO-UHFFFAOYSA-N | | SMILES | C1(C2=NC=C(CO)C=C2)=NC=C(CO)C=C1 |
| | [2,2'-Bipyridine]-5,5'-diMethanol Usage And Synthesis |
| Uses | 2,2'-Bipyridine-5,5'-diethanol can be used as an organic intermediate and a reference standard for traditional Chinese medicine. |
| | [2,2'-Bipyridine]-5,5'-diMethanol Preparation Products And Raw materials |
|