|
|
| | fluoroMethyl 4-Methylbenzenesulfonate Basic information |
| Product Name: | fluoroMethyl 4-Methylbenzenesulfonate | | Synonyms: | fluoroMethyl 4-Methylbenzenesulfonate;Methanol, 1-fluoro-, 1-(4-methylbenzenesulfonate);FMTS;Methanol, fluoro-, 4-methylbenzenesulfonate;Fluoromethyl p-Toluenesulfonate;luoroMethyl 4-Methylbenzenesulfonate;Fluoromethyl 4-methylbenzenesulfonate 97+%;fluoromethanol,4-methylbenzenesulfonic acid | | CAS: | 114435-86-8 | | MF: | C8H9FO3S | | MW: | 204.22 | | EINECS: | 810-390-1 | | Product Categories: | | | Mol File: | 114435-86-8.mol |  |
| | fluoroMethyl 4-Methylbenzenesulfonate Chemical Properties |
| Boiling point | 302.1±22.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Colourless | | InChI | InChI=1S/C8H9FO3S/c1-7-2-4-8(5-3-7)13(10,11)12-6-9/h2-5H,6H2,1H3 | | InChIKey | RFCGZPLGJZELOK-UHFFFAOYSA-N | | SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)F |
| RIDADR | 3265 | | HazardClass | 8 | | PackingGroup | Ⅱ | | HS Code | 2904100090 |
| | fluoroMethyl 4-Methylbenzenesulfonate Usage And Synthesis |
| Synthesis | Methylene ditosylate (100 mg, 0.28 mmol) and caesium fluoride (213 mg, 1.4 mmol) were dissolved in tert-amyl alcohol (5 mL) and irradiated in a microwave for 15 minutes at 90 °C. The reaction was allowed to cool and the tert-amyl alcohol was removed under reduced pressure, ice-cold diethyl ether was added and the suspension filtered, and then washed with plenty of ice-cold diethyl ether. The filtrate was concentrated under reduced pressure to yield Fluoromethyl 4-Methylbenzenesulfonate as a colourless oil (49 mg, 88% yield). | | References | [1] Tetrahedron Letters, 2018, vol. 59, # 17, p. 1635 - 1637
[2] Bioorganic and Medicinal Chemistry Letters, 2015, vol. 25, # 18, p. 3956 - 3960
[3] Journal of Labelled Compounds and Radiopharmaceuticals, 2003, vol. 46, # 6, p. 555 - 566
[4] ChemMedChem, 2016, vol. 11, # 1, p. 108 - 118
[5] Patent: WO2012/40133, 2012, A2. Location in patent: Page/Page column 36-37 |
| | fluoroMethyl 4-Methylbenzenesulfonate Preparation Products And Raw materials |
|