| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Robenidine-d8 HCl
CAS:1173097-77-2
Purity:對照品 Package:10mg~500mg Remarks:AC001121D01
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Robenidine-d8 HCl
CAS:1173097-77-2
Remarks:CS-C-01303
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Robenidine-D8 hydrochloride
CAS:1173097-77-2
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Robenidine-d8 HCl [Bis(phenyl-d4)
CAS:1173097-77-2
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
Robenidine-d8 HCl manufacturers
|
| | Robenidine-d8 HCl Basic information |
| Product Name: | Robenidine-d8 HCl | | Synonyms: | Robenidine-d8 HCl;D8-Robenidine hydrochloride;Robenidine hydrochloride-[D8;Robenidine-d8 hydrochloride;Robenidine-D8 hydrochloride (Standard) | | CAS: | 1173097-77-2 | | MF: | C15H14Cl3N5 | | MW: | 370.66 | | EINECS: | | | Product Categories: | | | Mol File: | 1173097-77-2.mol |  |
| | Robenidine-d8 HCl Chemical Properties |
| solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to off-white | | Stability: | Hygroscopic | | Major Application | clinical testing | | InChI | 1S/C15H13Cl2N5.ClH/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12;/h1-10H,(H3,18,21,22);1H/b19-9+,20-10+;/i1D,2D,3D,4D,5D,6D,7D,8D; | | InChIKey | LTWIBTYLSRDGHP-YVXDQVGZSA-N | | SMILES | Cl.[2H]c1c([2H])c(\C=N\NC(=N)N\N=C\c2c([2H])c([2H])c(Cl)c([2H])c2[2H])c([2H])c([2H])c1Cl |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Robenidine-d8 HCl Usage And Synthesis |
| Uses | Robenidine-d8 HCl [Bis(phenyl-d4)] is the labeled version of Robenidine (R639000(P)), which is used as a coccidiostat. | | IC 50 | Coccidia |
| | Robenidine-d8 HCl Preparation Products And Raw materials |
|