| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Faropenem Impurity 43
CAS:195716-77-9
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Faropenem Impurity 29 Sodium
CAS:195716-77-9
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Faropenem Impurity Sodium Salt
CAS:195716-77-9
Purity:>95%
|
|
| | FaropeneM iMpurity Basic information |
| Product Name: | FaropeneM iMpurity | | Synonyms: | Faropenem Impurity 17 Sodium Salt;Faropenem Sodium Impurity Ⅰ:(Faropenem S isomer) (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2S)-tetrahydrofuran-2-yl]-4-sulfur Hetero-1-azabicyclo[3.2.0]hept-2-en-2-carboxylic acid sodium salt;Faropenem Impurity Sodium Salt;Faropenem Impurity 43;(5R,6S)-6-((R)-1-Hydroxyethyl)-7-oxo-3-((S)-tetrahydrofuran-2-yl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, Sodium Salt;Faropenem Impurity 29 Sodium;5R-[3(S*),5alpha,6alpha(R*)]-Faropenem Sodium Salt;Faropenem Impurity | | CAS: | 195716-77-9 | | MF: | C12H16NNaO5S | | MW: | 309.31 | | EINECS: | | | Product Categories: | | | Mol File: | 195716-77-9.mol |  |
| | FaropeneM iMpurity Chemical Properties |
| InChI | InChI=1/C12H15NO5S.Na.H/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6;;/h5-7,11,14H,2-4H2,1H3,(H,16,17);;/t5-,6+,7+,11-;;/s3 | | InChIKey | WYVIISIEIWZICH-ATDQRYBJNA-N | | SMILES | C(C1=C([C@H]2OCCC2)S[C@]2([H])[C@@]([H])([C@H](O)C)C(=O)N12)(=O)O.[NaH] |&1:3,9,11,13,r| |
| | FaropeneM iMpurity Usage And Synthesis |
| Uses | 5R-[3(S*),5α,6α(R*)]-Faropenem Sodium Salt is an impurity of Faropenenm (F103303), which is a useful research chemical compound. It can be used for its antimicrobial activity. |
| | FaropeneM iMpurity Preparation Products And Raw materials |
|