11-(Aminomethyl)tricosane manufacturers
|
| | 11-(Aminomethyl)tricosane Basic information |
| Product Name: | 11-(Aminomethyl)tricosane | | Synonyms: | 11-(Aminomethyl)tricosane;2-(Dec-1-yl)tetradecylamine;C1014NH2;2-decyl-1-tetradecylamine;1-Tetradecanamine, 2-decyl-;2-Decyl-1-tetradecanamine;2-Decyltetradecylamine;2-decyldecatetra-1-amine | | CAS: | 62281-07-6 | | MF: | C24H51N | | MW: | 353.67 | | EINECS: | | | Product Categories: | | | Mol File: | 62281-07-6.mol |  |
| | 11-(Aminomethyl)tricosane Chemical Properties |
| Boiling point | 418.3±13.0 °C(Predicted) | | density | 0.824±0.06 g/cm3(Predicted) | | pka | 10.70±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C24H51N/c1-3-5-7-9-11-13-14-16-18-20-22-24(23-25)21-19-17-15-12-10-8-6-4-2/h24H,3-23,25H2,1-2H3 | | InChIKey | ASAVFBNAUMXKHJ-UHFFFAOYSA-N | | SMILES | C(N)C(CCCCCCCCCC)CCCCCCCCCCCC |
| | 11-(Aminomethyl)tricosane Usage And Synthesis |
| Uses | 2-Decyltetradecylamine is used in the synthesis of co-polymers with application in organic thin-film transistors. |
| | 11-(Aminomethyl)tricosane Preparation Products And Raw materials |
| Preparation Products | 4,9-DibroMo-2,7-bis(2-decyltetradecyl)benzo[lMn][3,8]phenanthroline-1,3,6,8-tetraone-->Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone, 4,5,9,10-tetrabromo-2,7-bis(2-decyltetradecyl)- |
|