|
|
| | Methyl 2-Chloro-5-Methoxynicotinate Basic information |
| Product Name: | Methyl 2-Chloro-5-Methoxynicotinate | | Synonyms: | Methyl 2-Chloro-5-Methoxynicotinate;methyl 2-chloro-5-methoxypyridine-3-carboxylate;2-Chloro-5-methoxy-nicotinic acid methyl ester;3-Pyridinecarboxylic acid, 2-chloro-5-methoxy-, methyl ester | | CAS: | 1256791-15-7 | | MF: | C8H8ClNO3 | | MW: | 201.61 | | EINECS: | | | Product Categories: | | | Mol File: | 1256791-15-7.mol |  |
| | Methyl 2-Chloro-5-Methoxynicotinate Chemical Properties |
| storage temp. | Store at 0-8 °C | | form | solid | | InChI | 1S/C8H8ClNO3/c1-12-5-3-6(8(11)13-2)7(9)10-4-5/h3-4H,1-2H3 | | InChIKey | JYKTUKSGCDNJPO-UHFFFAOYSA-N | | SMILES | O=C(OC)C1=C(Cl)N=CC(OC)=C1 |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Methyl 2-Chloro-5-Methoxynicotinate Usage And Synthesis |
| | Methyl 2-Chloro-5-Methoxynicotinate Preparation Products And Raw materials |
|