Cy5-alkyne manufacturers
- Cyanine5 alkyne
-
-
2025-06-07
- CAS:1223357-57-0
- Min. Order: 1mg
- Purity: >99.00%
- Supply Ability: 1mg
|
| | Cy5-alkyne Basic information |
| Product Name: | Cy5-alkyne | | Synonyms: | Cy5-alkyne;lipo CY5 (Me) YNE.Cl;Clickable Cy5-alkyne;3,3-Dimethyl-1-(6-oxo-6-(prop-2-yn-1-ylamino)hexyl)-2-(5-(1,3,3-trimethylindolin-2-ylidene)penta-1,3-dien-1-yl)-3H-indol-1-ium chloride;[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-[hydroxy(phosphonooxy)phosphoryl]phosphonamidic acid | | CAS: | 1223357-57-0 | | MF: | C35H42ClN3O | | MW: | 556.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1223357-57-0.mol |  |
| | Cy5-alkyne Chemical Properties |
| storage temp. | -20°C | | solubility | Soluble in DMSO, DMF, DCM | | form | powder | | color | Brown to black | | Appearance | Dark blue solid | | ex/em | 640/664 nm (PBS buffer) | | ε(extinction coefficient) | 250000 L?mol?1?cm?1 | | Φ(quantum yield) | 0.2 | | InChIKey | VOWXUNAERRNFLE-UHFFFAOYSA-N | | SMILES | C([N+]1=C(C(C)(C)C2=CC=CC=C12)C=CC=CC=C1C(C2=CC=CC=C2N1C)(C)C)CCCCC(=O)NCC#C.[Cl-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Cy5-alkyne Usage And Synthesis |
| Description | Cy5 alkyne is a cynaine linker containing an alkyne group, which enables Click Chemistry to attach deeply colored and photostable Cyanine5 fluorophore to various azide-bearing molecules. Cyanine5 is a popular fluorophore that has been widely used for various applications including intact organism imaging. | | Chemical Properties | Appearance: Dark blue solid
ex/em: 640/664 nm (PBS buffer)
Extinction coefficient (ε): 250000 Lmol1cm1
Quantum yield (Φ): 0.2 | | Uses | Cyanine5 alkyne (Alkyne-Cy5) is a fluorescent dye used to label azide proteins and can be used to analyse post-translational modifications of proteins, glycosylation etc. Cyanine5 alkyne can also be used as a mitochondrial OXPHOS inhibitor to inhibit the growth of cancer stem cells (CSC)[1][2]. Cyanine5 alkyne is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | | References | [1] Amanda R Burnham-Marusich, et al. Size-matched alkyne-conjugated cyanine fluorophores to identify differences in protein glycosylation. Electrophoresis. 2014 Sep;35(18):2621-5. DOI:10.1002/elps.201400241
[2] Camillo Sargiacomo, et al. MitoTracker Deep Red (MTDR) Is a Metabolic Inhibitor for Targeting Mitochondria and Eradicating Cancer Stem Cells (CSCs), With Anti-Tumor and Anti-Metastatic Activity In Vivo. Front Oncol. 2021 Jul 30;11:678343. DOI:10.3389/fonc.2021.678343 | | Abs/Em Maxima | 646/662 nm | | Fluoresene quantum yield | 0.2 | | Extinction Coefficient | 250000 | | CF260 | 0.03 | | CF280 | 0.04 | | Microscopy Laser Line | 633 or 635 nm | | Flow Cytometry Laser Line | 633 or 635 nm | | Spectrally Similar Dyes | Alexa Fluor? 647, CF? 647 Dye, DyLight?649 |
| | Cy5-alkyne Preparation Products And Raw materials |
|