|
|
| | Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine (1:1) Basic information |
| Product Name: | Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine (1:1) | | Synonyms: | (Dichloromethylene)bis(phosphonic acid) - N,N-dibutyl-1-butanamine (1:1);Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine (1:1);Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine;Phosphonic acid,P,P'-(dichloromethylene)bis-,compd.with N,N-...;Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine (1;Tributylamine (dichloromethylene)bis(phosphonate) | | CAS: | 163706-61-4 | | MF: | C13H31Cl2NO6P2 | | MW: | 430.24 | | EINECS: | | | Product Categories: | | | Mol File: | 163706-61-4.mol |  |
| | Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine (1:1) Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | InChI | InChI=1S/C12H27N.CH4Cl2O6P2/c1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3,10(4,5)6)11(7,8)9/h4-12H2,1-3H3;(H2,4,5,6)(H2,7,8,9) | | InChIKey | NDWFZUQKBXXXGW-UHFFFAOYSA-N | | SMILES | N(CCCC)(CCCC)CCCC.C(Cl)(Cl)(P(O)(O)=O)P(O)(O)=O |
| | Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine (1:1) Usage And Synthesis |
| Uses | (Dichloromethylene)bis[phosphonic acid] mono(tributylamine) salt can be used as a reactant in the synthetic preparation of uracil nucleotide derivatives and analogs |
| | Phosphonic acid, P,P'-(dichloromethylene)bis-, compd. with N,N-dibutyl-1-butanamine (1:1) Preparation Products And Raw materials |
|