| Company Name: |
Chengdu Saint - Kay Biotechnology Co., Ltd.
|
| Tel: |
028-85157043 15882256948 |
| Email: |
676046971@qq.com |
| Products Intro: |
Product Name:3- methoxy acetamide -5- (2,3- dihydroxyl procarbamide) -2,4,6- triiodobenzoyl chloride CAS:76350-04-4 Package:1KG;8KG
|
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Tel: |
0371-55055611 18137792234 |
| Email: |
3957071458@qq.com |
| Products Intro: |
Product Name:5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride CAS:76350-04-4 Purity:98% Package:1g;5g;10g;25g;100g;500g;1kg;5kg
|
|
| | 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride Basic information |
| Product Name: | 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride | | Synonyms: | 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride;Iopromide P-1;Benzoyl chloride, 3-[[(2,3-dihydroxypropyl)amino]carbonyl]-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]-;3- methoxy acetamide -5- (2,3- dihydroxyl procarbamide) -2,4,6- triiodobenzoyl chloride | | CAS: | 76350-04-4 | | MF: | C14H14ClI3N2O6 | | MW: | 722.44 | | EINECS: | | | Product Categories: | | | Mol File: | 76350-04-4.mol |  |
| | 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride Chemical Properties |
| Boiling point | 679.0±55.0 °C(Predicted) | | density | 2.355±0.06 g/cm3(Predicted) | | pka | 10.45±0.70(Predicted) | | InChI | InChI=1S/C14H14ClI3N2O6/c1-26-4-6(23)20-12-10(17)7(13(15)24)9(16)8(11(12)18)14(25)19-2-5(22)3-21/h5,21-22H,2-4H2,1H3,(H,19,25)(H,20,23) | | InChIKey | XDXXSXCEMRKYEK-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=C(I)C(NC(COC)=O)=C(I)C(C(NCC(O)CO)=O)=C1I |
| | 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride Usage And Synthesis |
| Uses | 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride is an important intermediate for the synthesis of Iopromide, which is an iodinated contrast medium for X-ray imaging. It is also an important organic reagent for the synthesis of many organic compounds. | | Preparation | N-[3,5-Bis(chlorocarbonyl)-2,4,6-triiodophenyl]amine (100g, 0.17mol) ) was added with 100ml of DMA to dissolve, and methoxyacetyl chloride (27.3g, 0.25mol) was added dropwise at 20°C for about 1 hour. The reaction was kept at 20-30°C for 5-8 hours. Cool the mixture to 5°C, water, potassium carbonate (58.7 g, 0.42 mol), 400 ml of dichloromethane, and 3-amino-1,2-propanediol (17.8 g, 0.2 mol) were added dropwise. After 8 hours, 400 ml of cold water was quickly added to the reaction solution. After crystallization, filtered, washed with a small amount of water, and dried to obtain 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride.  |
| | 5-methoxyacetylamino-2,4,6-triiodoisophthalic acid (2,3-dihydroxypropyl)amide chloride Preparation Products And Raw materials |
|