|
|
| | Parecoxib Sodium Impurity 14 Basic information |
| Product Name: | Parecoxib Sodium Impurity 14 | | Synonyms: | Parecoxib Sodium impurity S;parecoxib meta isomer;N-((3-(5-Methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)propionamide (Palbociclib Impurity);N-[[3-(5-methyl-3-phenyl-4-isoxazolyl)phenyl]sulfonyl]-;Valdecoxib IMpurity K;Propanamide, N-[[3-(5-methyl-3-phenyl-4-isoxazolyl)phenyl]sulfonyl]-;Parecoxib impurity 1/N-((3-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)propionamide;Parecoxib Sodium-17 | | CAS: | 1709956-89-7 | | MF: | C19H18N2O4S | | MW: | 370.42 | | EINECS: | | | Product Categories: | | | Mol File: | 1709956-89-7.mol |  |
| | Parecoxib Sodium Impurity 14 Chemical Properties |
| density | 1.264±0.06 g/cm3(Predicted) | | pka | 5.24±0.10(Predicted) | | InChI | InChI=1S/C19H18N2O4S/c1-3-17(22)21-26(23,24)16-11-7-10-15(12-16)18-13(2)25-20-19(18)14-8-5-4-6-9-14/h4-12H,3H2,1-2H3,(H,21,22) | | InChIKey | LBJQZHNREKXOHS-UHFFFAOYSA-N | | SMILES | C(NS(C1=CC=CC(C2=C(C)ON=C2C2=CC=CC=C2)=C1)(=O)=O)(=O)CC |
| | Parecoxib Sodium Impurity 14 Usage And Synthesis |
| | Parecoxib Sodium Impurity 14 Preparation Products And Raw materials |
|