|
|
| | 3-NITROPHENYLACETONITRILE Basic information |
| | 3-NITROPHENYLACETONITRILE Chemical Properties |
| Melting point | 60-62 °C(lit.) | | Boiling point | 180 °C3 mm Hg(lit.) | | density | 1.3264 (rough estimate) | | refractive index | 1.5770 (estimate) | | storage temp. | -20°C Freezer | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | color | Pale Yellow to Light Brown | | InChI | 1S/C8H6N2O2/c9-5-4-7-2-1-3-8(6-7)10(11)12/h1-3,6H,4H2 | | InChIKey | WAVKEPUFQMUGBP-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc(CC#N)c1 | | CAS DataBase Reference | 621-50-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | AM1247000 | | HazardClass | IRRITANT-HARMFUL | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 3-NITROPHENYLACETONITRILE Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 3-Nitrophenylacetonitrile (cas# 621-50-1) is a compound useful in organic synthesis. | | General Description | 3-Nitrophenylacetonitrile is a builing block. Reactions of 3-nitrophenylacetonitrile with isopropyl alcohol, cyclohexyl alcohol and benzyl alcohol at high temperature have been reported. |
| | 3-NITROPHENYLACETONITRILE Preparation Products And Raw materials |
|