| Company Name: |
ShenZhen Davoos Tech Ltd Gold
|
| Tel: |
0752-5555973 13923768523 |
| Email: |
95372103@qq.com |
| Products Intro: |
Product Name:Tenofovir Monomethyl Ester
CAS:1796539-83-7
Purity:95%+ Package:10mg/;20mg/;50mg/;100mg/;200mg/
|
|
| | Tenofovir Monomethyl Ester Basic information |
| Product Name: | Tenofovir Monomethyl Ester | | Synonyms: | QNIIFMBLEIMHIO-SSDOTTSWSA-N;Tenofovir disoproxil Impurity 4(Tenofovir Monomethyl Ester);Tenofovir Impurity 98;enofovir Monomethyl Ester;TAF-IM-G1;Tenofovir alafenamide-27;Phosphonic acid, P-[[(1R)-2-(6-amino-9H-purin-9-yl)-1-methylethoxy]methyl]-, monomethyl ester | | CAS: | 1796539-83-7 | | MF: | C10H16N5O4P | | MW: | 301.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1796539-83-7.mol |  |
| | Tenofovir Monomethyl Ester Chemical Properties |
| Boiling point | 544.5±60.0 °C(Predicted) | | density | 1.63±0.1 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 2.54±0.10(Predicted) | | color | Pale Beige to Light Yellow | | InChI | InChI=1S/C10H16N5O4P/c1-7(19-6-20(16,17)18-2)3-15-5-14-8-9(11)12-4-13-10(8)15/h4-5,7H,3,6H2,1-2H3,(H,16,17)(H2,11,12,13)/t7-/m1/s1 | | InChIKey | QNIIFMBLEIMHIO-SSDOTTSWSA-N | | SMILES | P(CO[C@H](C)CN1C2C(N=C1)=C(N)N=CN=2)(=O)(O)OC |
| | Tenofovir Monomethyl Ester Usage And Synthesis |
| Uses | Acyclic phosphonate nucleotide analogue; reverse transcriptase inhibitor. Used as an anti-HIV agent. Antiviral. |
| | Tenofovir Monomethyl Ester Preparation Products And Raw materials |
|