|
|
| | (S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL Basic information |
| Product Name: | (S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL | | Synonyms: | S-MTF-PEL;(S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL;(S)-(-)-1-(m-Trifluoromethylphenyl)ethanol;(αS)-α-Methyl-3-(trifluoromethyl)-benzenemethanol;(αS)-α-Methyl-3-(trifluoromethyl)-benzenemethanol,99%e.e.;Benzenemethanol, a-methyl-3-(trifluoromethyl)-, (aS)-;(S)-1-[3-(Trifluoromethyl)phenyl]ethanol 97%;(1S)-1-[3-(trifluoromethyl)phenyl]ethan-1-ol | | CAS: | 96789-80-9 | | MF: | C9H9F3O | | MW: | 190.16 | | EINECS: | | | Product Categories: | | | Mol File: | 96789-80-9.mol | ![(S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL Structure](CAS/GIF/96789-80-9.gif) |
| | (S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL Chemical Properties |
| Boiling point | 207℃ | | density | 1.234 | | Fp | 96℃ | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C9H9F3O/c1-6(13)7-3-2-4-8(5-7)9(10,11)12/h2-6,13H,1H3/t6-/s3 | | InChIKey | YNVXCOKNHXMBQC-ISZMHOAENA-N | | SMILES | C1(C(F)(F)F)=CC=CC([C@@H](O)C)=C1 |&1:9,r| |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2906290090 |
| | (S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL Usage And Synthesis |
| Uses | (S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL is a useful research chemical. |
| | (S)-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHANOL Preparation Products And Raw materials |
|