ERYTHROSIN B manufacturers
- Erythrosin B
-
- $40.00
-
2026-07-15
- CAS:15905-32-5
- Purity: 98.77%
- Supply Ability: 10g
- Erythrosin B
-
- $40.00
-
2026-07-15
- CAS:15905-32-5
- Purity: 98.77%
- Supply Ability: 10g
- Erythrosin B
-
- $50.00
-
2025-05-26
- CAS:15905-32-5
- Purity: 98.36%
- Supply Ability: 10g
|
| | ERYTHROSIN B Basic information |
| Product Name: | ERYTHROSIN B | | Synonyms: | 2’,4’,5’,7’-tetraiodo-fluorescei;2’,4’,5’,7’-tetraiodofluorescein;3’,6’-Dihydroxy-2’,4’,5’,7’-tetraiodospiro[iso-benzofuran-1(3H),9’-[9H]xanthen]-3-onedisodiumsalt;9’-(9h)xanthen)-3-one,3’,6’-dihydroxy-2’,4’,5’,7’-spiro(isobenzofuran-1(3h;9’-[9H]xanthen]-3-one,3’,6’-dihydroxy-2’,4’,5’,7’-tetraiodo-Spiro[isobenzofuran-1(3H);erythrosineacid;iodeosin;Erythrosin B, spirit soluble, pure, 95% | | CAS: | 15905-32-5 | | MF: | C20H8I4O5 | | MW: | 835.89 | | EINECS: | 240-046-0 | | Product Categories: | Inhibitors;Organics | | Mol File: | 15905-32-5.mol |  |
| | ERYTHROSIN B Chemical Properties |
| Melting point | 303 °C (dec.)(lit.) | | Boiling point | 628.3±55.0 °C(Predicted) | | density | 2.4391 (estimate) | | storage temp. | room temp | | solubility | spirit: soluble | | form | powder | | Colour Index | 45430:2 | | pka | 7.21±0.20(Predicted) | | color | Red | | Water Solubility | Soluble in water, spirit, methanol, methyl cellosolve and ethanol. | | ε(extinction coefficient) | ≥102000 at 526-534nm at 0.005g/L (95% Methanol 5% 0.1M Na2CO3)
≥13000 at 310-318nm in 1 M NH4OH at 0.005g/L (95% Methanol 5% 0.1M Na2CO3)
≥32000 at 258-266nm at 0.005g/L (95% Methanol 5% 0.1M Na2CO3) | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C20H8I4O5/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20/h1-6,25-26H | | InChIKey | OALHHIHQOFIMEF-UHFFFAOYSA-N | | SMILES | Oc1c(I)cc2c(Oc3c(I)c(O)c(I)cc3C24OC(=O)c5ccccc45)c1I | | EPA Substance Registry System | |
| Safety Statements | 22-24/25 | | WGK Germany | 2 | | RTECS | LM5940000 | | TSCA | TSCA listed | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Toxicity | A
food color formerly approved for use in the United States and
Europe. It was used primarily in jams and marmalades, maraschino
cherries, pickles and relishes, etc. The LD50 in rats is
150 mg/kg, i.p., and 600 mg/kg, p.o. Erythrosine has a variety of
actions in vitro due in large measure to its ability to affect biological
membranes and lipophilic sites of enzymes. Such data have
led to the hypothesis that erythrosine could be neurotoxic, but
both clinical and preclinical data have suggested that erythrosine
is not likely to be neurotoxic at doses that might be encountered.
Two other toxicological issues have been raised with this food
color. It has been suggested to be a potential, if weak, carcinogen,
and it may also contribute to potential thyroid toxicity resulting
from release of iodine. |
| | ERYTHROSIN B Usage And Synthesis |
| Chemical Properties | orange-red fine powder | | Uses | Erythrosin B has been used as a dye in fluorescence lifetime imaging. | | Uses | Indicator in analytical chemistry. | | Uses | Erythrosin B is used as a red coloring in some foods such as cherries and fish. It is used as printing ink, dental plaque disclosing agent and biological stain. It finds application as a radiopaque medium and sensitizer for orthochromatic photographic films. It is utilized as a cake-decorating gel. In addition to this, it is used in sweets such as candies and popsicles. | | Preparation | Fluorescein (C.I.Acid Yellow 73, C.L 45350) in aqueous solution or Tetraiodide in ethanol, and made the free acid form. | | Biochem/physiol Actions | Erythrosin B, also called as eosin B, is a xanthene dye. It belongs to the family of fluorescein dyes. It plays a major role in inhibiting dopamine uptake and high affinity 3H-ouabain binding and ion transport in synaptosomes from rat caudate nucleus. | | Properties and Applications | blue light red. Soluble in water for cherry red, no fluorescence. In concentrated sulfuric acid for brown light yellow, dilution after brown light yellow precipitation. Dye aqueous solution to join sodium hydroxide have soluble precipitation. Used in cosmetics coloring.
|
Standard
|
Light Fastness
|
Heat-resistant(℃)
|
water
|
Sodium Carbonate(5%)
|
Hydrochloric acid(5%)
|
|
Melting point
|
Stable
|
|
ISO
|
Poor
|
|
|
Insoluble
|
|
|
|
| | ERYTHROSIN B Preparation Products And Raw materials |
|