- ()-α-Gurjunene
-
- $15.00
-
2021-07-02
- CAS:489-40-7
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | (-)-ALPHA-GURJUNENE Basic information |
| Product Name: | (-)-ALPHA-GURJUNENE | | Synonyms: | (-)-ALPHA-GURJUNENE;(2S,4R,7R,8R)-3,3,7,11-TETRAMETHYL-TRICYCLO[6.3.0.02.4]UNDEC-1(11)-ENE;(-)-α-gurjunene;1,1,4,7-Tetramethyl-1a,2,3,4,4a,5,6,7b-octahydro-1H-cyclopropa[e]azulene;1a,2,3,4,4a,5,6,7b-octahydro-1,1,4,7-tetramethyl-,[1aR-(1a.alpha.,4.alpha.,4a.beta.,7b.alpha.)]-1H-Cycloprop[e]azulene;1a,2,3,4,4a,5,6,7b-octahydro-1,1,4,7-tetramethyl-1h-cycloprop[e]azulen[1a;1H-Cycloprop[e]azulene, 1a,2,3,4,4a,5,6,7b-octahydro-1,1,4,7-tetramethyl-, (1aalpha,4alpha,4abeta,7balpha)-;1H-Cycloprop[e]azulene, 1a,2,3,4,4a,5,6,7b-octahydro-1,1,4,7-tetramethyl-, [1aR-(1aalpha,4alpha,4abeta,7balpha)]- | | CAS: | 489-40-7 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 207-695-1 | | Product Categories: | | | Mol File: | 489-40-7.mol |  |
| | (-)-ALPHA-GURJUNENE Chemical Properties |
| Boiling point | 76-77 °C(Press: 3 Torr) | | density | 0.918 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.501 | | Fp | 110℃ | | storage temp. | 2-8°C | | Odor | at 100.00 %. wood balsam | | Odor Type | woody | | Optical Rotation | [α]20/D 213±5°, neat | | BRN | 1939514 | | Major Application | food and beverages | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9,11-12,14H,5-8H2,1-4H3/t9-,11-,12-,14-/m1/s1 | | InChIKey | SPCXZDDGSGTVAW-XIDUGBJDSA-N | | SMILES | C1[C@@]2([H])C([C@]3([H])C(C)(C)[C@]3([H])CC[C@H]2C)=C(C)C1 | | LogP | 6.386 (est) | | EPA Substance Registry System | 1H-Cycloprop[e]azulene, 1a,2,3,4,4a,5,6,7b-octahydro-1,1,4,7-tetramethyl-, (1aR,4R,4aR,7bS)- (489-40-7) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | (-)-ALPHA-GURJUNENE Usage And Synthesis |
| Uses | α-Gurjunene is an essential oil extract of Salvia tomentosa Miller, researched for Antimicrobial and antioxidant activities. |
| | (-)-ALPHA-GURJUNENE Preparation Products And Raw materials |
|