|
|
| | Hydrocortisone 21-hemisuccinate Basic information |
| Product Name: | Hydrocortisone 21-hemisuccinate | | Synonyms: | hydrocortisone 21-(hydrogen succinate);hydrocortisone 21-hemisuccinate*free acid;11β,17α,21-trihydroxy-4-pregnene-3,20-dione 21-hemisuccinate;HYDROCORTISONEHEMISUCCINATE(ANHYDROUS);Cortisol, 21-(hydrogen succinate) (8CI);Cortisol, hydrogen succinate (7CI);NSC 7576;Pregn-4-ene-3,20-dione, 21-(3-carboxy-1-oxopropoxy)-11,17-dihydroxy-, (11β)- | | CAS: | 2203-97-6 | | MF: | C25H34O8 | | MW: | 462.53 | | EINECS: | 218-612-3 | | Product Categories: | Steroid and Hormone;Steroids;APIs | | Mol File: | 2203-97-6.mol |  |
| | Hydrocortisone 21-hemisuccinate Chemical Properties |
| Melting point | 170～172℃ | | alpha | [α]D20 +147～+153° (c=1, C2H5OH) (After Drying) | | Boiling point | 685.5±55.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Practically insoluble in water, freely soluble in acetone and in anhydrous ethanol. It dissolves in dilute solutions of alkali carbonates and alkali hydroxides. | | form | Solid | | pka | pKa 5.10/5.64(20% aq EtOH/50% aq EtOH) (Uncertain) | | color | White to Off-White | | Major Application | forensics and toxicology
pharmaceutical (small molecule)
veterinary | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | VWQWXZAWFPZJDA-CGVGKPPMSA-N | | SMILES | C[C@]12CCC(=O)C=C1CC[C@H]3[C@@H]4CC[C@](O)(C(=O)COC(=O)CCC(O)=O)[C@@]4(C)C[C@H](O)[C@H]23 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | TU5010147 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | Hydrocortisone 21-hemisuccinate Usage And Synthesis |
| Chemical Properties | White or almost white, hygroscopic powder | | Uses | glucocorticoid | | Uses | Hydrocortisone 21-hemisuccinate is a corticosteroid used as an analytical and chromatography reagent. | | Definition | ChEBI: A derivative of succinic acid in which one of the carboxy groups is esterified by the C-21 hydroxy group of cortisol (hydrocortisone). | | Brand name | A-Hydrocort (Abbott); A-Hydrocort (Hospira); Solu-Cortef
(Pharmacia & Upjohn). |
| | Hydrocortisone 21-hemisuccinate Preparation Products And Raw materials |
|