| Company Name: |
ShangHai Angti Biotechnology Co., Ltd.
|
| Tel: |
13764913901 |
| Email: |
info@angtibio.com |
| Products Intro: |
Product Name:1-(tert-Butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate CAS:206111-36-6
|
1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate manufacturers
|
| | 1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate Basic information |
| Product Name: | 1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate | | Synonyms: | 1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate;O1-tert-butyl O4-ethyl (+)-(3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate;1,4-Piperidinedicarboxylic acid, 3-hydroxy-, 1-(1,1-dimethylethyl) 4-ethyl ester, (3R,4R)-rel-(+)-;Ethyl (3R,4R)-1-Boc-3-hydroxypiperidine-4-carboxylate;O1-tert-butyl O4-ethyl (+)-(3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate - [B84607] | | CAS: | 206111-36-6 | | MF: | C13H23NO5 | | MW: | 273.32542 | | EINECS: | | | Product Categories: | | | Mol File: | 206111-36-6.mol |  |
| | 1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate Chemical Properties |
| Boiling point | 366.8±42.0 °C(Predicted) | | density | 1.159±0.06 g/cm3(Predicted) | | pka | 14.10±0.40(Predicted) | | InChI | InChI=1S/C13H23NO5/c1-5-18-11(16)9-6-7-14(8-10(9)15)12(17)19-13(2,3)4/h9-10,15H,5-8H2,1-4H3/t9-,10+/m1/s1 | | InChIKey | AKHBRSJRXLGZJK-ZJUUUORDSA-N | | SMILES | C(N1CC[C@@H](C(=O)OCC)[C@@H](O)C1)(=O)OC(C)(C)C |
| | 1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate Usage And Synthesis |
| Uses | 1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate is a heterocyclic organic compound used as a pharmaceutical intermediate for pharmaceutical synthesis and experimental research. |
| | 1-(tert-butyl) 4-ethyl (3R,4R)-3-hydroxypiperidine-1,4-dicarboxylate Preparation Products And Raw materials |
|