|
|
| | 9 10-ANTHRACENEDIYL-BIS(METHYLENE) Basic information |
| Product Name: | 9 10-ANTHRACENEDIYL-BIS(METHYLENE) | | Synonyms: | 9 10-ANTHRACENEDIYL-BIS(METHYLENE);biochemika90%(hpce);9,10-Anthracenedipropanoicacid, a10,a9-dicarboxy-;2,2'-(Anthracene-9,10-diylbis(methylene);α,α'-(anthracene-9,10-diyl)bis(methylmalonic)acid;9,10-Anthracenedipropanoic acid, α9,α10-dicarboxy-;2,2'-(Anthracene-9,10-diylbis(methylene))dimalonic acid;9,10-Anthracenediyl-bis(methylene)dimalonicaci | | CAS: | 307554-62-7 | | MF: | C22H18O8 | | MW: | 410.38 | | EINECS: | | | Product Categories: | | | Mol File: | 307554-62-7.mol |  |
| | 9 10-ANTHRACENEDIYL-BIS(METHYLENE) Chemical Properties |
| Melting point | >300 °C | | Boiling point | 745.4±60.0 °C(Predicted) | | density | 1.527±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO: soluble | | form | A crystalline solid | | pka | 2.90±0.30(Predicted) | | color | Light yellow to yellow | | BRN | 3503804 | | InChI | 1S/C22H18O8/c23-19(24)17(20(25)26)9-15-11-5-1-2-6-12(11)16(10-18(21(27)28)22(29)30)14-8-4-3-7-13(14)15/h1-8,17-18H,9-10H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30) | | InChIKey | DNUYOWCKBJFOGS-UHFFFAOYSA-N | | SMILES | C(C1=C2C=CC=CC2=C(CC(C(=O)O)C(=O)O)C2C=CC=CC1=2)C(C(=O)O)C(=O)O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 9 10-ANTHRACENEDIYL-BIS(METHYLENE) Usage And Synthesis |
| Uses | Reagent for the assay of O2; it has better characteristics than 9,10-anthracenediyl-bis-dipropionic acid. |
| | 9 10-ANTHRACENEDIYL-BIS(METHYLENE) Preparation Products And Raw materials |
|