| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:4-(3,5-Difluorophenyl)-4-oxobutyric acid CAS:302912-30-7 Purity:97% Package:1G,5G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:4-(3,5-Difluorophenyl)-4-oxobutyric acid CAS:302912-30-7 Purity:98% Remarks:B35782
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:4-(3,5-Difluorophenyl)-4-oxobutyric acid CAS:302912-30-7 Purity:97% Package:5G Remarks:514683-5G
|
| Company Name: |
Shanghai Fluoking Chemicals Co., Ltd.
|
| Tel: |
21-21-021-31009277 13918871782;13761216778 |
| Email: |
fluoking@fluoking.com |
| Products Intro: |
Product Name:4-(3,5-difluorophenyl)-4-oxobutanoic acid CAS:302912-30-7 Purity:>98% Package:100g;500g; 1kg;5kg;25-100-500kg
|
|
| | 4-(3 5-DIFLUOROPHENYL)-4-OXOBUTYRIC ACID Basic information |
| | 4-(3 5-DIFLUOROPHENYL)-4-OXOBUTYRIC ACID Chemical Properties |
| Melting point | 116-119 °C (lit.) | | Boiling point | 366.3±32.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | pka | 4.31±0.17(Predicted) | | InChI | 1S/C10H8F2O3/c11-7-3-6(4-8(12)5-7)9(13)1-2-10(14)15/h3-5H,1-2H2,(H,14,15) | | InChIKey | SSBFKGDYTIRSOC-UHFFFAOYSA-N | | SMILES | OC(=O)CCC(=O)c1cc(F)cc(F)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(3 5-DIFLUOROPHENYL)-4-OXOBUTYRIC ACID Usage And Synthesis |
| | 4-(3 5-DIFLUOROPHENYL)-4-OXOBUTYRIC ACID Preparation Products And Raw materials |
|