|
|
| | 1 5-DINITROANTHRAQUINONE 97 Basic information |
| Product Name: | 1 5-DINITROANTHRAQUINONE 97 | | Synonyms: | 1,5-dinitro-10-anthracenedione;1,5-Dinitro-9,10-anthracenedione;1,5-dinitroanthrachinon;1,5-dinitro-anthraquinon;10-Anthracenedione,1,5-dinitro-9;1 5-DINITROANTHRAQUINONE 97;1,5-dinitroanthracene-9,10-dione;1,5-Dinitroanthraquinone | | CAS: | 82-35-9 | | MF: | C14H6N2O6 | | MW: | 298.21 | | EINECS: | 201-414-6 | | Product Categories: | Intermediates of Dyes and Pigments;C13 to C14;Carbonyl Compounds;Ketones | | Mol File: | 82-35-9.mol |  |
| | 1 5-DINITROANTHRAQUINONE 97 Chemical Properties |
| Melting point | 250 °C (dec.) (lit.) | | Boiling point | 439.64°C (rough estimate) | | density | 1.4281 (rough estimate) | | refractive index | 1.5910 (estimate) | | solubility | Acetonitrile (Very Slightly), DMSO (Slightly), Methanol (Very Slightly) | | form | Solid | | color | Pale Yellow to Yellow | | InChI | 1S/C14H6N2O6/c17-13-7-3-1-5-9(15(19)20)11(7)14(18)8-4-2-6-10(12(8)13)16(21)22/h1-6H | | InChIKey | XVMVHWDCRFNPQR-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc2C(=O)c3c(cccc3[N+]([O-])=O)C(=O)c12 | | EPA Substance Registry System | 9,10-Anthracenedione, 1,5-dinitro- (82-35-9) |
| WGK Germany | 2 | | RTECS | CB6950000 | | TSCA | TSCA listed | | Storage Class | 4.1A - Other explosive hazardous materials |
| | 1 5-DINITROANTHRAQUINONE 97 Usage And Synthesis |
| Chemical Properties | Crystallized as light yellow needle crystals. Soluble in hot nitrobenzene, slightly soluble in hot xylene, slightly soluble in acetic acid, very slightly soluble in ethanol, ether, benzene. | | Uses | 1,5-Dinitroanthraquinone has been used in a study to understand the effect of its oxygenous substituents on the color ratio, when it is a part of spectral flare compositions. It may be used to prepare 3,4,7,8-tetrabromo-1,5-dinitroanthraquinone via bromination using molecular bromine and nitric acid as a co-reagent. | | General Description | 1,5-Dinitroanthraquinone is formed as one of the products during the nitration of anthraquinone. |
| | 1 5-DINITROANTHRAQUINONE 97 Preparation Products And Raw materials |
|