| Company Name: |
Shanghai EFE Biological Technology Co., Ltd.
|
| Tel: |
021-65675885 18964387627 |
| Email: |
info@efebio.com |
| Products Intro: |
Product Name:1,2-Dioleoyl-sn-glycero-3-EPC (chloride)
CAS:474945-24-9
Purity:95% Package:5mg;10mg;25mg
|
|
| | 18:1 EPC (Cl Salt) Basic information |
| Product Name: | 18:1 EPC (Cl Salt) | | Synonyms: | 18:1 EPC (Cl Salt);1,2-Dioleoyl-sn-glycero-3-EPC (chloride);18:1 EPC chloride;1,2-Dioleoyl-sn-glycero-3-ethylphosphocholine Chloride Salt | | CAS: | 474945-24-9 | | MF: | C46H89ClNO8P | | MW: | 850.64 | | EINECS: | | | Product Categories: | | | Mol File: | 474945-24-9.mol |  |
| | 18:1 EPC (Cl Salt) Chemical Properties |
| storage temp. | -20°C | | solubility | Ethanol: 25 mg/ml | | form | powder | | color | Colorless to off-white | | InChIKey | LXTQBOAODSPEHG-NATHRRJOSA-M | | SMILES | O=P(OCC[N+](C)(C)C)(OC[C@]([H])(OC(CCCCCCC/C=C\CCCCCCCC)=O)COC(CCCCCCC/C=C\CCCCCCCC)=O)OCC.[Cl-] |
| Storage Class | 11 - Combustible Solids |
| | 18:1 EPC (Cl Salt) Usage And Synthesis |
| Description | 18:1 EPC (Cl Salt) is a cationic derivatives of phospholipids consisting entirely of biological metabolites linked with two 18-carbon fatty acid tails with single alkene groups in each tail. The lipid has low toxicity and is biodegradable. | | Uses | 1,2-Dioleoyl-sn-glycero-3-ethylphosphocholine Chloride Salt is used in the development of nanoparticle-based vectors for improved siRNA delivery efficiency of nucleic acid carriers. |
| | 18:1 EPC (Cl Salt) Preparation Products And Raw materials |
|