- Bromopropylate
-
- $10.00
-
2026-03-20
- CAS:18181-80-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Bromopropylate
-
-
2025-12-01
- CAS:18181-80-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kgs
- Bromopropylate
-
-
2020-04-28
- CAS:18181-80-1
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 500 tons
|
| | Bromopropylate Basic information |
| Product Name: | Bromopropylate | | Synonyms: | 4-Bromo-alpha-(4-bromophenyl)-alpha-hydroxybenzeneacetic acid 1-methylethyl ester;ACAROL;ACAROL (TM);BROMPROPYLAT;BROMPROPYLATE;4-bromo-alpha-(4-bromophenyl)-alpha-hydroxy-benzeneaceticaci1-methylethyl;4-bromo-alpha-(4-bromophenyl)-alpha-hydroxybenzeneaceticacid1-methylethyl;4-bromo-alpha-(4-bromophenyl)-alpha-hydroxybenzeneaceticacid1-methylethyles | | CAS: | 18181-80-1 | | MF: | C17H16Br2O3 | | MW: | 428.12 | | EINECS: | 242-070-7 | | Product Categories: | | | Mol File: | 18181-80-1.mol |  |
| | Bromopropylate Chemical Properties |
| Melting point | 77° | | Boiling point | 504°C (rough estimate) | | density | 1.5582 (rough estimate) | | refractive index | 1.6010 (estimate) | | Fp | >100 °C | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 11.18±0.29(Predicted) | | color | White to Off-White | | Water Solubility | <0.5mg/L(20 ºC) | | BRN | 2152560 | | Henry's Law Constant | 2.1×101 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | Major Application | agriculture
environmental | | InChI | 1S/C17H16Br2O3/c1-11(2)22-16(20)17(21,12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-11,21H,1-2H3 | | InChIKey | FOANIXZHAMJWOI-UHFFFAOYSA-N | | SMILES | CC(C)OC(=O)C(O)(c1ccc(Br)cc1)c2ccc(Br)cc2 | | CAS DataBase Reference | 18181-80-1(CAS DataBase Reference) | | NIST Chemistry Reference | Bromopropylate(18181-80-1) | | EPA Substance Registry System | Bromopropylate (18181-80-1) |
| Hazard Codes | Xi | | Risk Statements | 38 | | WGK Germany | 2 | | RTECS | DD2100000 | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 | | Hazardous Substances Data | 18181-80-1(Hazardous Substances Data) | | Toxicity | LD50 orally in rats: 5000 mg/kg (Kenaga, Allison) |
| | Bromopropylate Usage And Synthesis |
| Chemical Properties | White crystal. Melting point 77℃, relative density 1.59, vapor pressure 1.066×10-5Pa (20℃), 0.7Pa (100℃). Soluble in acetone, benzene, isopropyl alcohol, methanol, xylene and other organic solvents; solubility in water at 20 ℃ <0.5mg/kg. stable in storage at room temperature, stable in neutral medium, unstable in acidic or alkaline conditions. | | Uses | Bromopropylate is a chemical compound used as an acaricide against spider mites in apiaries and on fruit crops such as citrus and grapes. | | Uses | Acaricide. |
| | Bromopropylate Preparation Products And Raw materials |
|