|
|
| | 1,4-DIBROMO-2,3-BIS(BROMOMETHYL)-2-BUTENE Basic information |
| Product Name: | 1,4-DIBROMO-2,3-BIS(BROMOMETHYL)-2-BUTENE | | Synonyms: | TIMTEC-BB SBB007706;TETRAKIS(BROMOMETHYL)ETHYLENE;1,4-DIBROMO-2,3-BIS(BROMOMETHYL)-2-BUTENE;2,3-bis(bromomethyl)-1,4-dibromo-2-buten;2,3-bis(bromomethyl)-1,4-dibromo-2-butene;2,3-di(Bromomethyl)-1,4-dibrom butene-2;2-Butene, 2,3-bis(bromomethyl)-1,4-dibromo-;Tetra(bromomethyl)ethene | | CAS: | 30432-16-7 | | MF: | C6H8Br4 | | MW: | 399.74 | | EINECS: | | | Product Categories: | | | Mol File: | 30432-16-7.mol |  |
| | 1,4-DIBROMO-2,3-BIS(BROMOMETHYL)-2-BUTENE Chemical Properties |
| Melting point | 158-159 °C(Solv: cyclohexane (110-82-7)) | | Boiling point | 380℃ | | density | 2.303 | | Fp | 177℃ | | storage temp. | 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H8Br4/c7-1-5(2-8)6(3-9)4-10/h1-4H2 | | InChIKey | GJZKNORRVIUCCH-UHFFFAOYSA-N | | SMILES | C(Br)/C(/CBr)=C(\CBr)/CBr |
| | 1,4-DIBROMO-2,3-BIS(BROMOMETHYL)-2-BUTENE Usage And Synthesis |
| Description | 1,4-Dibromo-2,3-bis(bromomethyl)-2-butene can be used in the synthesis of a wide variety of organic compounds. It is activated with silicon and germanium to produce a reactive intermediate that can then be reacted to form substituted cyclohexanes. This compound can also be used in the synthesis of heterocycles such as hexamethylbenzene and dibenzothiophene. It is prepared by the stepwise addition of bromine to pentane. | | Uses | 1,4-Dibromo-2,3-bis(bromomethyl)but-2-ene can be used as ubiquitin specific peptidase 9X inhibitors to treat cancer. |
| | 1,4-DIBROMO-2,3-BIS(BROMOMETHYL)-2-BUTENE Preparation Products And Raw materials |
| Raw materials | 2-Butene, 1,4-dibromo-2,3-dimethyl-, (2Z)--->1,4-Dibromo-2,3-dimethyl-2-butene-->2,3-DIMETHYL-2-BUTANOL-->1,2-DIBROMO-3,3-DIMETHYLBUTANE-->1-BROMO-3,3-DIMETHYLBUTANE-->2,3-Dimethyl-1-butene-->2,3-Dimethylbutane-->2,3-Dimethyl-2-butene-->3,3-Dimethyl-1-butene-->2,3-DIMETHYL-1,3-BUTADIENE |
|