- Boc-L-Cys(Acm)-OH
-
-
2026-07-24
- CAS:19746-37-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Boc-Cys(Acm)-OH
-
- $1.00
-
2020-01-06
- CAS:19746-37-3
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
- BOC-CYS(ACM)-OH
-
- $7.00
-
2019-09-02
- CAS: 19746-37-3
- Min. Order: 1KG
- Purity: 99%
|
| | BOC-CYS(ACM)-OH Basic information |
| | BOC-CYS(ACM)-OH Chemical Properties |
| Melting point | 111-114 °C | | Boiling point | 531.5±50.0 °C(Predicted) | | density | 1.231±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble in Methanol | | form | powder to crystaline | | pka | 3.54±0.10(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D 36.5±1.5°, c = 1% in H2O | | BRN | 2058303 | | Major Application | peptide synthesis | | InChI | 1S/C11H20N2O5S/c1-7(14)12-6-19-5-8(9(15)16)13-10(17)18-11(2,3)4/h8H,5-6H2,1-4H3,(H,12,14)(H,13,17)(H,15,16)/t8-/m0/s1 | | InChIKey | HLCTYBOTPCIHTG-QMMMGPOBSA-N | | SMILES | CC(=O)NCSC[C@H](NC(=O)OC(C)(C)C)C(O)=O | | CAS DataBase Reference | 19746-37-3(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | BOC-CYS(ACM)-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Boc-Cys(Acm)-OH, is a Cystine derivative, used in various chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-CYS(ACM)-OH Preparation Products And Raw materials |
|