| Company Name: |
Hubei Moco Chemical Co., Ltd.
|
| Tel: |
18627753421; 18627756402 |
| Email: |
3001051413@qq.com |
| Products Intro: |
Product Name:Vitamin C Impurity 18
CAS:1354064-87-1
Purity:95% HPLC Package:25mg;50mg;100mg;200mg
|
| Company Name: |
TargetMol Chemicals Inc.
|
| Tel: |
15002134094 |
| Email: |
marketing@targetmol.cn |
| Products Intro: |
Product Name:Ascorbic acid-13C6
CAS:1354064-87-1
Package:5mg;1mg
|
Ascorbic acid 13C6 manufacturers
|
| | Ascorbic acid 13C6 Basic information |
| Product Name: | Ascorbic acid 13C6 | | Synonyms: | Ascorbic acid 13C6Q: What is
Ascorbic acid 13C6 Q: What is the CAS Number of
Ascorbic acid 13C6 Q: What is the storage condition of
Ascorbic acid 13C6 Q: What are the applications of
Ascorbic acid 13C6;L-ASCORBIC ACID (VITAMIN C) (13C6, 99%) 500 UG/ML IN WATER:ACETONITRILE;Vitamin C Impurity 18;L-Ascorbic acid-13C6;Ascorbic Acid SR Pellets 85%;L-Ascorbic Acid-13C6 (Vitamin C-13C6);Ascorbic Acid-13C6 (Standard) | | CAS: | 1354064-87-1 | | MF: | C6H8O6 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![Ascorbic acid 13C6 Structure]() |
| | Ascorbic acid 13C6 Chemical Properties |
| Melting point | 193°C | | form | powder | | color | white to off-white | | InChI | 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | CIWBSHSKHKDKBQ-RQFYRPEFSA-N | | SMILES | O[13C]([13C@]([13C@@H](O)[13CH2]O)([H])O1)=[13C](O)[13C]1=O |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Ascorbic acid 13C6 Usage And Synthesis |
| Uses | L-Ascorbic acid-13C6 can be used as a stable isotope internal standard for accurate data interpretation in specific biological samples by LC-MS/MS. |
| | Ascorbic acid 13C6 Preparation Products And Raw materials |
|