|
|
| | potassium ethyl oxalate Basic information |
| Product Name: | potassium ethyl oxalate | | Synonyms: | Oxalic acid 1-ethyl 2-potassium salt;EINECS 217-606-8;Ethanedioic acid, monoethyl ester, potassium salt;NSC 6390;Oxalic acid, monoethyl ester, potassium salt;potassium 2-ethoxy-2-keto-acetate;potassium 2-ethoxy-2-oxo-acetate;potassium 2-ethoxy-2-oxo-ethanoate | | CAS: | 1906-57-6 | | MF: | C4H6O4.K | | MW: | 157.19 | | EINECS: | 217-606-8 | | Product Categories: | | | Mol File: | 1906-57-6.mol |  |
| | potassium ethyl oxalate Chemical Properties |
| Melting point | 220-223℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C4H6O4.K/c1-2-8-4(7)3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1 | | InChIKey | RLPQQBNSTHRHEK-UHFFFAOYSA-M | | SMILES | C(=O)(C([O-])=O)OCC.[K+] | | EPA Substance Registry System | Ethanedioic acid, monoethyl ester, potassium salt (1906-57-6) |
| TSCA | TSCA listed | | HazardClass | 6.1 | | HS Code | 2917110099 |
| | potassium ethyl oxalate Usage And Synthesis |
| Uses | Ethyl potassium oxalate is used to prepare oxalic acid ethyl ester 2-oxo-3-phenyl-propyl ester by reacting with 1-bromo-3-phenyl-acetone. |
| | potassium ethyl oxalate Preparation Products And Raw materials |
|