|
|
| | zinc bis[p-toluenesulphinate] Basic information |
| | zinc bis[p-toluenesulphinate] Chemical Properties |
| Melting point | 251 °C (decomp)(Solv: ethanol (64-17-5)) | | vapor pressure | 0.004-0.006Pa at 20-40℃ | | InChI | InChI=1S/2C7H8O2S.Zn/c2*1-6-2-4-7(5-3-6)10(8)9;/h2*2-5H,1H3,(H,8,9);/q;;+2/p-2 | | InChIKey | KHYUFILZGMOXBR-UHFFFAOYSA-L | | SMILES | [Zn+2].C1(S([O-])=O)=CC=C(C)C=C1.C1(S([O-])=O)=CC=C(C)C=C1 | | LogP | 5.041 at 25℃ and pH7 | | EPA Substance Registry System | Benzenesulfinic acid, 4-methyl-, zinc salt (24345-02-6) |
| | zinc bis[p-toluenesulphinate] Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Zinc bis[p-toluenesulphinate] is used as a foaming accelerator in the preparation of low-smoke, high-flame-retardant rubber and plastic thermal insulation materials. |
| | zinc bis[p-toluenesulphinate] Preparation Products And Raw materials |
|