- 2-Bromostyrene
-
- $2.00
-
2019-07-06
- CAS:2039-88-5
- Min. Order: 1kg
- Purity: 99%
|
| | 2-Bromostyrene Basic information |
| | 2-Bromostyrene Chemical Properties |
| Melting point | 7°C | | Boiling point | 102-104 °C/22 mmHg (lit.) | | density | 1.46 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.592(lit.) | | Fp | 186 °F | | storage temp. | 2-8°C | | solubility | Miscible with methanol. | | form | clear liquid | | Specific Gravity | 1.4160 | | color | Colorless to Yellow | | BRN | 2323537 | | InChI | InChI=1S/C8H7Br/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2 | | InChIKey | SSZOCHFYWWVSAI-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC=C1C=C | | CAS DataBase Reference | 2039-88-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-bromo-2-ethenyl-(2039-88-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29036990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromostyrene Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | 2-Bromostyrene is used as a cross linking agent in fire-resistant bromostyrene-crosslinked polyesters. Further, it is used to prepare trans-1-(2-bromophenyl)-2-(3-bromophenyl)ethene by reacting with 1-bromo-3-iodo-benzene, involving palladium(II) acetate as catalyst. |
| | 2-Bromostyrene Preparation Products And Raw materials |
|