PERFLUORO(METHYLDECALIN) manufacturers
|
| | PERFLUORO(METHYLDECALIN) Basic information |
| Product Name: | PERFLUORO(METHYLDECALIN) | | Synonyms: | 1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-Heptadecafluoro-1-(trifluoromethyl)decalin;GZN Fluid (PERFLUOROMETHYLDECALIN);Perfluoro-1-;1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-Heptadecafluoro-8-(trifluoromethyl)decahydronaphthalene;Heptadecafluorodecahydro-1-(trifluoromethyl)naphthalene;Naphthalene, 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluorodecahydro-8-(trifluoromethyl)-;Perfluoro-1-methyldecaline;PERFLUORO(1-METHYLDECALIN) | | CAS: | 306-92-3 | | MF: | C11F20 | | MW: | 512.09 | | EINECS: | 206-191-9 | | Product Categories: | | | Mol File: | 306-92-3.mol |  |
| | PERFLUORO(METHYLDECALIN) Chemical Properties |
| Melting point | −40 °C(lit.) | | Boiling point | 137-160 °C(lit.) | | density | 1.95 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.317(lit.) | | Fp | >230 °F | | form | liquid | | color | Clear, colourless | | Specific Gravity | 1.960 | | InChI | InChI=1S/C22H42O3/c1-3-5-7-14-17-21(23)18-15-12-10-8-9-11-13-16-19-22(24)25-20-6-4-2/h12,15,21,23H,3-11,13-14,16-20H2,1-2H3/b15-12-/t21-/m1/s1 | | InChIKey | LWRNQOBXRHWPGE-UHFFFAOYSA-N | | SMILES | FC12C(C(F)(C(F)(F)F)C(F)(F)C(F)(F)C2(F)F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F | | CAS DataBase Reference | 306-92-3(CAS DataBase Reference) | | EPA Substance Registry System | Naphthalene, 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluorodecahydro-8-(trifluoromethyl)- (306-92-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 41 | | WGK Germany | 3 | | RTECS | QJ3155000 | | TSCA | TSCA listed | | HS Code | 2903898090 | | Storage Class | 10 - Combustible liquids |
| | PERFLUORO(METHYLDECALIN) Usage And Synthesis |
| Uses | Perfluoromethyldecalin is used as a blood substitute and as a perfluorocarbon tracer. |
| | PERFLUORO(METHYLDECALIN) Preparation Products And Raw materials |
|