|
|
| | N-succinimidyl-4-((iodoacetyl)amino)benzoate Basic information |
| | N-succinimidyl-4-((iodoacetyl)amino)benzoate Chemical Properties |
| Melting point | 19-7-200°C (dec.) | | density | 1.87±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetontrile (Slightly), DMSO (Slightly) | | pka | 12.16±0.70(Predicted) | | form | Solid | | color | Pale Yellow | | InChI | 1S/C13H11IN2O5/c14-7-10(17)15-9-3-1-8(2-4-9)13(20)21-16-11(18)5-6-12(16)19/h1-4H,5-7H2,(H,15,17) | | InChIKey | BQWBEDSJTMWJAE-UHFFFAOYSA-N | | SMILES | O=C(CCC1=O)N1OC(C2=CC=C(NC(CI)=O)C=C2)=O |
| WGK Germany | WGK 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids |
| | N-succinimidyl-4-((iodoacetyl)amino)benzoate Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent.
Spacer Arm: 10.6 Angstroms | | Uses | A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent. Spacer Arm: 10.6 Angstroms | | General Description | SIAB is an amine- and sulfhydryl-reactive heterobifunctional crosslinker and Sulfo-SIAB is its water-soluble analog. These crosslinkers contain an amine-reactive N-hydroxysuccimide (NHS) ester and a sulfhydryl-reactive iodoacetyl group, and are often used for preparing enzyme conjugates or immunotoxins. Water-soluble and water-insoluble forms of NHS esters have essentially identical reactivity. Sulfo-SIAB is supplied as a sodium salt and is water-soluble to ~10mM. SIAB must be first dissolved in an organic solvent, such as DMSO or DMF, and then added to the aqueous reaction mixture. SIAB is lipophilic, membrane-permeable and does not possess a charged group. | | reaction suitability | reagent type: cross-linking reagent |
| | N-succinimidyl-4-((iodoacetyl)amino)benzoate Preparation Products And Raw materials |
|