| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Simazine-d10
CAS:220621-39-6
Purity:對照品 Package:10mg~500mg Remarks:CC000129D01
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:SiMazine-d10
CAS:220621-39-6
Remarks:CS-C-01031
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:SiMazine D10
CAS:220621-39-6
Purity:98% Package:10Mg 25Mg 100Mg
|
| Company Name: |
Chengdu RunZeBenTu Chemical Co., Ltd
|
| Tel: |
13096311329 028-88469284 616445927 |
| Email: |
616445927@qq.com |
| Products Intro: |
Product Name:SIMAZINE D10
CAS:220621-39-6
Package:5g/25g/100g/250g/500g
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Simazine D10
CAS:220621-39-6
Purity:99% Package:10mg;100mg;1g
|
|
| | SIMAZINE D10 Basic information |
| Product Name: | SIMAZINE D10 | | Synonyms: | SIMAZINE D10;SIMAZINE-D10 (DIETHYL-D10);2,4-BIS(PENTADEUTEROETHYLAMINO)-6-CHLORO-1,3,5-TRIAZINE;Simazine-d10;6-chloro-2-N,4-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine;D10-Simazine;Simazine D10Q: What is
Simazine D10 Q: What is the CAS Number of
Simazine D10 Q: What is the storage condition of
Simazine D10 Q: What are the applications of
Simazine D10;Simazine D10 100 μg/mL in Acetone | | CAS: | 220621-39-6 | | MF: | C7H2ClD10N5 | | MW: | 211.72 | | EINECS: | | | Product Categories: | | | Mol File: | 220621-39-6.mol |  |
| | SIMAZINE D10 Chemical Properties |
| storage temp. | 0-6°C | | solubility | DMF: slightly soluble,DMSO: slightly soluble | | Stability: | Hygroscopic | | Major Application | agriculture
environmental | | InChI | 1S/C7H12ClN5/c1-3-9-6-11-5(8)12-7(13-6)10-4-2/h3-4H2,1-2H3,(H2,9,10,11,12,13)/i1D3,2D3,3D2,4D2 | | InChIKey | ODCWYMIRDDJXKW-MWUKXHIBSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])Nc1nc(Cl)nc(NC([2H])([2H])C([2H])([2H])[2H])n1 |
| Hazard Codes | Xn,N | | Risk Statements | 40-50/53 | | Safety Statements | 36/37-46-60-61 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2 |
| | SIMAZINE D10 Usage And Synthesis |
| Uses | Simazine-d10 is the isotope labelled analog of Simazine (S465900); a selective pre-emergence herbicide. |
| | SIMAZINE D10 Preparation Products And Raw materials |
|