| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Thiochrome
CAS:92-35-3
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
- THIOCHROME
-
-
2025-12-24
- CAS:92-35-3
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
- Thiochrome
-
- $64.00
-
2025-07-18
- CAS:92-35-3
- Purity:
- Supply Ability: 10g
|
| | THIOCHROME Basic information |
| Product Name: | THIOCHROME | | Synonyms: | 5-d]thiazolo[3,2-a]pyrimidine-8-ethanol,2,7-dimethyl-5h-pyrimido[;THIOCHROME;2,7-DIMETHYL-5H-THIACHROMINE-8-ETHANOL;2,7-DIMETHYLTHIACHROMINE-8-ETHANOL;2-(2,7-dimethyl-5H-thiazolo(3,2:1,2)pyrimido(4,5-d)pyrimidin-8-yl)ethanol;2,7-Dimethyl-5H-pyrimido[4,5-d]thiazolo[3,2-a]pyrimidine-8-ethanol;8-(2-Hydroxyethyl)-2,7-dimethyl-5H-pyrimido[4,5-d]thiazolo[3,2-a]pyrimidine;5H-Pyrimido(4,5-D)thiazolo(3,2-A)pyrimidine-8-ethanol, 2,7-dimethyl- | | CAS: | 92-35-3 | | MF: | C12H14N4OS | | MW: | 262.33 | | EINECS: | 202-149-9 | | Product Categories: | | | Mol File: | 92-35-3.mol |  |
| | THIOCHROME Chemical Properties |
| Melting point | 228.8°C | | Boiling point | 462.6±55.0 °C(Predicted) | | density | 1.2444 (rough estimate) | | refractive index | 1.6440 (estimate) | | storage temp. | Store at -20°C | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 14+-.0.10(Predicted) | | color | Light yellow to yellow | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | 1S/C12H14N4OS/c1-7-10(3-4-17)18-12-15-11-9(6-16(7)12)5-13-8(2)14-11/h5,17H,3-4,6H2,1-2H3 | | InChIKey | GTQXMAIXVFLYKF-UHFFFAOYSA-N | | SMILES | Cc1ncc2CN3C(C)=C(CCO)SC3=Nc2n1 | | EPA Substance Registry System | 5H-Pyrimido[4,5-d]thiazolo[3,2-a]pyrimidine-8-ethanol, 2,7-dimethyl- (92-35-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | THIOCHROME Usage And Synthesis |
| Uses | Thiochrome is a selective M4 muscarinic receptor enhancer of acetylcholine affinity. | | Biological Activity | Selective M4 muscarinic receptor enhancer of acetylcholine affinity. | | in vivo | Thiochrome can increase the intensity of the reproduction process of the representatives of one-cell organisms worms, crustaceans, insects and fishes[1]. | | Purification Methods | Crystallise thiochrome from chloroform. The monohydrochloride has m 235-236o(dec) (from EtOH) and the dihydrochloride has m 237o(dec). [Beilstein 27 III/IV 9599.] |
| | THIOCHROME Preparation Products And Raw materials |
|