(S)-(4-Chlorophenyl)(pyridin-2-yl)methanol manufacturers
|
| | (S)-(4-Chlorophenyl)(pyridin-2-yl)methanol Basic information |
| Product Name: | (S)-(4-Chlorophenyl)(pyridin-2-yl)methanol | | Synonyms: | (S)-(4-Chlorophenyl)(pyridin-2-yl)methanol;(S)-(4-chlorophenyl)(pyridine-2yl)Methanol (S forM);(S)-alpha-(4-chlorophenyl)pyridine-2-methanol;2-Pyridinemethanol, α-(4-chlorophenyl)-, (αS)-;(S)-(4-Chlorophenyl)(pyridin-2-yl)methanol - [C91327];Carbinoxamine Impurity 12;(S)-(4-chlorophenyl)(pyridine-2-yl)methylol | | CAS: | 176022-47-2 | | MF: | C12H10ClNO | | MW: | 219.67 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 176022-47-2.mol |  |
| | (S)-(4-Chlorophenyl)(pyridin-2-yl)methanol Chemical Properties |
| Melting point | 84-86 °C | | Boiling point | 364.3±32.0 °C(Predicted) | | density | 1.275±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.46±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C12H10ClNO/c13-10-6-4-9(5-7-10)12(15)11-3-1-2-8-14-11/h1-8,12,15H/t12-/s3 | | InChIKey | ZFUPOFQRQNJDNS-PLAQIDKDNA-N | | SMILES | C1=CN=C([C@H](C2C=CC(Cl)=CC=2)O)C=C1 |&1:4,r| |
| | (S)-(4-Chlorophenyl)(pyridin-2-yl)methanol Usage And Synthesis |
| | (S)-(4-Chlorophenyl)(pyridin-2-yl)methanol Preparation Products And Raw materials |
|