|
|
| | 2-(Diphenylphosphino)-2'-methoxybiphenyl Basic information |
| Product Name: | 2-(Diphenylphosphino)-2'-methoxybiphenyl | | Synonyms: | 2-(Diphenylphosphino)-2'-methoxybiphenyl;(2'-Methoxy-[1,1'-biphenyl]-2-yl)diphenylphosphine;2-(DiphenylphosphiNA)-2'-Methoxybiphenyl;2-(Diphenylphosphino)-2'-Metho;(2'-Methoxybiphenyl-2-yl)diphenylphosphine;(2'-Methoxybiphenyl-2-yl)diphenylpho;Phosphine, (2'-methoxy[1,1'-biphenyl]-2-yl)diphenyl-;(2'-methoxy-[1,1'-biphenyl]-2-yl)diphenylphosphane | | CAS: | 402822-70-2 | | MF: | C25H21OP | | MW: | 368.41 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 402822-70-2.mol |  |
| | 2-(Diphenylphosphino)-2'-methoxybiphenyl Chemical Properties |
| Melting point | 175-176 °C | | Boiling point | 478.2±28.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | InChI | InChI=1S/C25H21OP/c1-26-24-18-10-8-16-22(24)23-17-9-11-19-25(23)27(20-12-4-2-5-13-20)21-14-6-3-7-15-21/h2-19H,1H3 | | InChIKey | HKPVWDCYRDZOLZ-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC=C1C1=CC=CC=C1OC)(C1=CC=CC=C1)C1=CC=CC=C1 |
| | 2-(Diphenylphosphino)-2'-methoxybiphenyl Usage And Synthesis |
| | 2-(Diphenylphosphino)-2'-methoxybiphenyl Preparation Products And Raw materials |
|