|
|
| | OlMesartan Lactone IMpurity Basic information |
| Product Name: | OlMesartan Lactone IMpurity | | Synonyms: | 3,6-Dihydro-6,6-dimethyl-2-propyl-3-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-4H-furo[3,4-d]imidazol-4-one;Olmesartan Lactone Impurity A;Olmesartan impuirty B;Olmesartan MedoxomiI Impurity B;Olmesartan Related Compound A;Olmesartan Medoxomil EP Impurity B, RNH-6352;3-((2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)-6,6-dimethyl-2-propyl-3,6-dihydro-4H-furo[3,4-d]imidazol-4-one;Olmesartan Medoxomil Related Compound A (20 mg) (1-{[2'-(1H-Tetrazol-5-yl)biphenyl-4-yl]methyl}-4,4-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-6(4H)-one) | | CAS: | 849206-43-5 | | MF: | C24H24N6O2 | | MW: | 428.49 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 849206-43-5.mol |  |
| | OlMesartan Lactone IMpurity Chemical Properties |
| Melting point | 173 - 175°C (Subl.) | | Boiling point | 701.6±70.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.16±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C24H24N6O2/c1-4-7-19-25-21-20(23(31)32-24(21,2)3)30(19)14-15-10-12-16(13-11-15)17-8-5-6-9-18(17)22-26-28-29-27-22/h5-6,8-13H,4,7,14H2,1-3H3,(H,26,27,28,29) | | InChIKey | JUQNVWFXORBZQJ-UHFFFAOYSA-N | | SMILES | [nH]1nnnc1c2c(cccc2)c3ccc(cc3)C[n]4c5c(nc4CCC)C(OC5=O)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | OlMesartan Lactone IMpurity Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Olmesartan Lactone Impurity (Olmesartan EP Impurity B) is a cyclic ester impurity of Olmesartan (O550000). |
| | OlMesartan Lactone IMpurity Preparation Products And Raw materials |
|