| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:2-ethyl-6-nitro-1,3-benzoxazole CAS:13243-39-5 Purity:95+% Package:1g;5gG;10g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:2-Ethyl-6-nitrobenzoxazole CAS:13243-39-5 Purity:95% Package:5g Remarks:NULL
|
|
| | 2-Ethyl-6-nitrobenzoxazole Basic information |
| | 2-Ethyl-6-nitrobenzoxazole Chemical Properties |
| Melting point | 85-86 °C | | Boiling point | 312.4±15.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -1.50±0.30(Predicted) | | form | solid | | InChI | 1S/C9H8N2O3/c1-2-9-10-7-4-3-6(11(12)13)5-8(7)14-9/h3-5H,2H2,1H3 | | InChIKey | PCGXXJTVFLMTPJ-UHFFFAOYSA-N | | SMILES | CCC(O1)=NC(C1=C2)=CC=C2[N+]([O-])=O |
| WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-Ethyl-6-nitrobenzoxazole Usage And Synthesis |
| | 2-Ethyl-6-nitrobenzoxazole Preparation Products And Raw materials |
|