|
|
| | 1,4-Di(1H-pyrazol-4-yl)benzene Basic information |
| Product Name: | 1,4-Di(1H-pyrazol-4-yl)benzene | | Synonyms: | H2bpzb;1,4-benzenedi(4'-pyrazolyl);1,4-Di(4'-pyrazolyl)benzene, Min. 97%;1,4-Di(1H-pyrazol-4-yl)benzene;1,4-DI(4'-PYRAZOLYL)BENZENE,MIN.97%H2BDP;1,4-bis(1-H-pyrazol-4-yl)benzene;4-(4-(1H-pyrazol-4-yl)phenyl)-1H-pyrazole;1H-Pyrazole, 4,4'-(1,4-phenylene)bis- | | CAS: | 1036248-62-0 | | MF: | C12H10N4 | | MW: | 210.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1036248-62-0.mol |  |
| | 1,4-Di(1H-pyrazol-4-yl)benzene Chemical Properties |
| Melting point | >360 °C (sublm) | | Boiling point | 578.0±43.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 13.38±0.50(Predicted) | | form | solid | | color | pale yellow | | InChI | InChI=1S/C12H10N4/c1-2-10(12-7-15-16-8-12)4-3-9(1)11-5-13-14-6-11/h1-8H,(H,13,14)(H,15,16) | | InChIKey | RUGLQPNWHSDVER-UHFFFAOYSA-N | | SMILES | C1(C2=CNN=C2)=CC=C(C2=CNN=C2)C=C1 |
| | 1,4-Di(1H-pyrazol-4-yl)benzene Usage And Synthesis |
| Uses | 1,4-Di(1H-pyrazol-4-yl)benzene belongs to a class of organic ligands containing 1H-imidazol-4-yl-type groups. It can function as both anionic and neutral ligands versatile for the construction of metal-organic frameworks (MOFs) with definite structures and properties.[1] | | Uses |
[1] Liu, Z.-Q., Zhao, Y., Zhang, X.-D., Kang, Y.-S., Lu, Q.-Y., Azam, M., Al-Resayes, S. I., & Sun, W.-Y. (2017). Metal–organic frameworks with 1,4-di(1H-imidazol-4-yl)benzene and varied carboxylate ligands for selectively sensing Fe(iii) ions and ketone molecules?. Dalton Transactions, 40, 13943–13951. https://doi.org/10.1039/C7DT02981K
|
| | 1,4-Di(1H-pyrazol-4-yl)benzene Preparation Products And Raw materials |
|