|
|
| | (2E)-4-Methoxy-2-butenoic Acid Basic information |
| | (2E)-4-Methoxy-2-butenoic Acid Chemical Properties |
| Melting point | 66-67 °C | | Boiling point | 248.3±23.0 °C(Predicted) | | density | 1.098±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.37±0.10(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C5H8O3/c1-8-4-2-3-5(6)7/h2-3H,4H2,1H3,(H,6,7)/b3-2+ | | InChIKey | ZOJKRWXDNYZASL-NSCUHMNNSA-N | | SMILES | C(O)(=O)/C=C/COC |
| | (2E)-4-Methoxy-2-butenoic Acid Usage And Synthesis |
| Uses | (2E)-4-Methoxy-2-butenoic Acid is used in the protection of hydroxy groups in molecules forming esters such as cronate. |
| | (2E)-4-Methoxy-2-butenoic Acid Preparation Products And Raw materials |
|