| Company Name: |
Henan Tianfu Chemical Co.,Ltd. |
| Tel: |
+86-0371-55170693 +86-19937530512 |
| Email: |
info@tianfuchem.com |
| Products Intro: |
Product Name:1,3,5,2,4,6-triazatriphosphorine, 2-ethoxy-2,4,4,6,6-pentafluoro-2,2,4,4,6,6-hexahydro-
CAS:33027-66-6
Purity:99% Package:25KG;5KG;1KG
|
|
|
|
|
| Company Name: |
career henan chemical co |
| Tel: |
+86-0371-86658258 |
| Email: |
sales@coreychem.com |
| Products Intro: |
Product Name:1,3,5,2,4,6-triazatriphosphorine, 2-ethoxy-2,4,4,6,6-pentafluoro-2,2,4,4,6,6-hexahydro-
CAS: 33027-66-6
Purity:99% Package:1kg;7USD
|
|
|
|
|
|
| | Ethoxy(pentafluoro)cyclotriphosphazene Basic information |
| Product Name: | Ethoxy(pentafluoro)cyclotriphosphazene | | Synonyms: | 1,3,5,2,4,6-triazatriphosphorine, 2-ethoxy-2,4,4,6,6-pentafluoro-2,2,4,4,6,6-hexahydro-;2-ethoxy-2,4,4,6,6-pentafluoro-2λ5,4λ5,6λ5-cyclotriphosphazene;2-Ethoxy-2,4,4,6,6-pentafluoro-1,3,5,2,4,6-triazatriphosphorine;2λ5,4λ5,6λ5-1,3,5,2,4,6-Triazatriphosphorine,2-ethoxy-2,4,4,6,6-pentafluoro-;JACS-33027-66-6;Ethoxy(pentafluoro)cyclotriphosphazene>;2-ethoxy-2,4,4,6,6-pentafluoro-1,3,5,2lambda~5~,4lambda~5~,6lambda~5~-triazatriphosphinine;Teflon triphosphazene | | CAS: | 33027-66-6 | | MF: | C2H5F5N3OP3 | | MW: | 275 | | EINECS: | 608-823-2 | | Product Categories: | | | Mol File: | 33027-66-6.mol |  |
| | Ethoxy(pentafluoro)cyclotriphosphazene Chemical Properties |
| Boiling point | 42°C/30mmHg(lit.) | | density | 2.08±0.1 g/cm3(Predicted) | | refractive index | 1.3610-1.3650 | | storage temp. | 0-10°C | | pka | -23.10±0.39(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C2H5F5N3OP3/c1-2-11-14(7)9-12(3,4)8-13(5,6)10-14/h2H2,1H3 | | InChIKey | CBTAIOOTRCAMBD-UHFFFAOYSA-N | | SMILES | O(P1(=NP(F)(F)=NP(F)(F)=N1)F)CC | | EPA Substance Registry System | Ethoxy(pentafluoro)cyclotriphosphazene (33027-66-6) |
| RIDADR | 1760 | | HS Code | 2934.99.9001 | | HazardClass | 8 | | PackingGroup | III |
| | Ethoxy(pentafluoro)cyclotriphosphazene Usage And Synthesis |
| Uses | Ethoxy(pentafluoro)cyclotriphosphazene (PFPN) is used as a high efficiency flame retardant in batteries. | | Battery Materials | In battery systems, including LiFePO4, LiNixCoyMnzO2, lithium metal, and SiOx/C anodes, PFPN have flame-retardant capability, also suppress electrolyte decomposition and enhance interfacial stability[1]. | | References | [1] Zhou, Z., Chen, G., Yu, G., Liu, X., & Chou, S. (2026) Recent Achievements on Nonflammable Electrolytes with Ethoxy(pentafluoro)cyclotriphosphazene for Stable and Safe Lithium-Ion Batteries. Chem. Sci., 2026, Accepted Manuscript. https://doi.org/10.1039/D6SC03275C
|
| | Ethoxy(pentafluoro)cyclotriphosphazene Preparation Products And Raw materials |
|