|
|
| | N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine Basic information |
| Product Name: | N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine | | Synonyms: | N4,N4′-di(Naphthalen-1-yl)-N4,N4′-bis(4- vinylphenyl)biphenyl-4,4′-diamine;N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine;N,N'-Bis(naphthalen-1-yl)-N,N'-bis(4-vinyl-phenyl)benzidine;[1,1'-Biphenyl]-4,4'-diamine, N4,N4'-bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-;N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine ISO 9001:2015 REACH;4,4′-Bis[(1-naphthyl)(4-styryl)amino][1,1′]biphenyl;N4,N4'-Di(naphthalen-1-yl)-N4,N4'-bis(4-vinylphenyl)-[1,1'-biphenyl]-4,4'-diamine;N4,N4'-Di(naphthalen-1-yl)-N4,N4'-bis(4-vinylphenyl)biphenyl-4,4'-diamine | | CAS: | 1010396-31-2 | | MF: | C48H36N2 | | MW: | 640.81 | | EINECS: | | | Product Categories: | | | Mol File: | 1010396-31-2.mol | ![N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine Structure](CAS/20150408/GIF/1010396-31-2.gif) |
| | N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine Chemical Properties |
| Boiling point | 825.3±65.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | solubility | THF: soluble chloroform: soluble toluene: soluble | | pka | 0.06±0.50(Predicted) | | λmax | 350 nm±5 nm in THF (UV) | | InChIKey | WTEWXIOJLNVYBZ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N(C3=CC=C(C=C)C=C3)C3=C4C(C=CC=C4)=CC=C3)C=C2)=CC=C(N(C2=CC=C(C=C)C=C2)C2=C3C(C=CC=C3)=CC=C2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine Usage And Synthesis |
| Uses | N4,N4μ-Di(naphthalen-1-yl)-N4,N4μ-bis(4-vinylphenyl)biphenyl-4,4μ-diamine, also known as VNPB, is a solution-processable Hole Transport / Electron Blocking Layer (HTL / EBL) material popularly used in organic electronics, such as OLEDs and perovskite solar cells . In OLED devices, the use of VNPB enabled the maximum current efficiency of 22.2 Cd/A, compared to 9.7 Cd/A in the reference device without VNPB, and the device lifetime was extended by up to 74.8% . VNPB allowed a simple and additive-free strategy to prevent the formation of defects in solution processed thin-film stacks made of small-molecular materials. In solar cells, VNPB increased open-circuit voltage (VOC) and power conversion efficiency (PCE) of wide-bandgap perovskite solar cells by changing the hole transport layer (HTL) from commonly used poly(bis(4-phenyl)(2,4,6-trimethylphenyl)amine) (PTAA) to in-situ cross-linked small mol. VNPB . PCEs of 24.9% and 25.4% have been achieved in perovskite/perovskite and perovskite/silicon tandem solar cells, resp. |
| | N4,N4'-Bis(4-ethenylphenyl)-N4,N4'-di-1-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine Preparation Products And Raw materials |
|