4',4''''-(1,4-PHENYLENE)BIS(2,2':6',2''-TERPYRIDINE) manufacturers
|
| | 4',4''''-(1,4-PHENYLENE)BIS(2,2':6',2''-TERPYRIDINE) Basic information |
| Product Name: | 4',4''''-(1,4-PHENYLENE)BIS(2,2':6',2''-TERPYRIDINE) | | Synonyms: | 1,4-Bis(2,2':6',2''-terpyridin-4'-yl)benzene;4`,4````-(1,4-Phenylene)bis(2,2`:6`,2``-terpyridine),96%;4',4''''-(1,4-PHENYLENE)BIS(2,2':6',2''-TERPYRIDINE);1,4-Di([2,2':6',2''-terpyridin]-4'-yl)benzene;2,2':6',2''-Terpyridine, 4',4''''-(1,4-phenylene)bis-;1,4-bis(4'-phenyl-2,2':6',2''-terpyridin-4'-yl)benzene;1,4-bis[2,2':6',2''-terpyridine-4'-yl]benzene;4-{4-[2,6-BIS(PYRIDIN-2-YL)PYRIDIN-4-YL]PHENYL}-2,6-BIS(PYRIDIN-2-YL)PYRIDINE | | CAS: | 146406-75-9 | | MF: | C36H24N6 | | MW: | 540.62 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;C9 to C46;Heterocyclic Building Blocks;Pyridines | | Mol File: | 146406-75-9.mol |  |
| | 4',4''''-(1,4-PHENYLENE)BIS(2,2':6',2''-TERPYRIDINE) Chemical Properties |
| Melting point | 340 °C (dec.)(lit.) | | Boiling point | 727.8±55.0 °C(Predicted) | | density | 1.227±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 4.73±0.22(Predicted) | | form | powder to crystal | | color | White to Yellow to Orange | | λmax | 292nm(CH2Cl2)(lit.) | | InChIKey | NXMHYAQTBVTLRK-UHFFFAOYSA-N | | SMILES | C1(C2C=C(C3=NC=CC=C3)N=C(C3=NC=CC=C3)C=2)=CC=C(C2C=C(C3=NC=CC=C3)N=C(C3=NC=CC=C3)C=2)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 2933.39.9200 |
| | 4',4''''-(1,4-PHENYLENE)BIS(2,2':6',2''-TERPYRIDINE) Usage And Synthesis |
| | 4',4''''-(1,4-PHENYLENE)BIS(2,2':6',2''-TERPYRIDINE) Preparation Products And Raw materials |
|